/** * matter-js 0.10.0 by @liabru 2016-05-01 * http://brm.io/matter-js/ * License MIT */ /** * The MIT License (MIT) * * Copyright (c) 2014 Liam Brummitt * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in * all copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN * THE SOFTWARE. */ (function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.Matter = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o 0) { Vector.rotateAbout(part.position, delta, body.position, part.position); } } }; /** * Sets the linear velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`. * @method setVelocity * @param {body} body * @param {vector} velocity */ Body.setVelocity = function(body, velocity) { body.positionPrev.x = body.position.x - velocity.x; body.positionPrev.y = body.position.y - velocity.y; body.velocity.x = velocity.x; body.velocity.y = velocity.y; body.speed = Vector.magnitude(body.velocity); }; /** * Sets the angular velocity of the body instantly. Position, angle, force etc. are unchanged. See also `Body.applyForce`. * @method setAngularVelocity * @param {body} body * @param {number} velocity */ Body.setAngularVelocity = function(body, velocity) { body.anglePrev = body.angle - velocity; body.angularVelocity = velocity; body.angularSpeed = Math.abs(body.angularVelocity); }; /** * Moves a body by a given vector relative to its current position, without imparting any velocity. * @method translate * @param {body} body * @param {vector} translation */ Body.translate = function(body, translation) { Body.setPosition(body, Vector.add(body.position, translation)); }; /** * Rotates a body by a given angle relative to its current angle, without imparting any angular velocity. * @method rotate * @param {body} body * @param {number} rotation */ Body.rotate = function(body, rotation) { Body.setAngle(body, body.angle + rotation); }; /** * Scales the body, including updating physical properties (mass, area, axes, inertia), from a world-space point (default is body centre). * @method scale * @param {body} body * @param {number} scaleX * @param {number} scaleY * @param {vector} [point] */ Body.scale = function(body, scaleX, scaleY, point) { for (var i = 0; i < body.parts.length; i++) { var part = body.parts[i]; // scale vertices Vertices.scale(part.vertices, scaleX, scaleY, body.position); // update properties part.axes = Axes.fromVertices(part.vertices); if (!body.isStatic) { part.area = Vertices.area(part.vertices); Body.setMass(part, body.density * part.area); // update inertia (requires vertices to be at origin) Vertices.translate(part.vertices, { x: -part.position.x, y: -part.position.y }); Body.setInertia(part, Vertices.inertia(part.vertices, part.mass)); Vertices.translate(part.vertices, { x: part.position.x, y: part.position.y }); } // update bounds Bounds.update(part.bounds, part.vertices, body.velocity); } // handle circles if (body.circleRadius) { if (scaleX === scaleY) { body.circleRadius *= scaleX; } else { // body is no longer a circle body.circleRadius = null; } } if (!body.isStatic) { var total = _totalProperties(body); body.area = total.area; Body.setMass(body, total.mass); Body.setInertia(body, total.inertia); } }; /** * Performs a simulation step for the given `body`, including updating position and angle using Verlet integration. * @method update * @param {body} body * @param {number} deltaTime * @param {number} timeScale * @param {number} correction */ Body.update = function(body, deltaTime, timeScale, correction) { var deltaTimeSquared = Math.pow(deltaTime * timeScale * body.timeScale, 2); // from the previous step var frictionAir = 1 - body.frictionAir * timeScale * body.timeScale, velocityPrevX = body.position.x - body.positionPrev.x, velocityPrevY = body.position.y - body.positionPrev.y; // update velocity with Verlet integration body.velocity.x = (velocityPrevX * frictionAir * correction) + (body.force.x / body.mass) * deltaTimeSquared; body.velocity.y = (velocityPrevY * frictionAir * correction) + (body.force.y / body.mass) * deltaTimeSquared; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.position.x += body.velocity.x; body.position.y += body.velocity.y; // update angular velocity with Verlet integration body.angularVelocity = ((body.angle - body.anglePrev) * frictionAir * correction) + (body.torque / body.inertia) * deltaTimeSquared; body.anglePrev = body.angle; body.angle += body.angularVelocity; // track speed and acceleration body.speed = Vector.magnitude(body.velocity); body.angularSpeed = Math.abs(body.angularVelocity); // transform the body geometry for (var i = 0; i < body.parts.length; i++) { var part = body.parts[i]; Vertices.translate(part.vertices, body.velocity); if (i > 0) { part.position.x += body.velocity.x; part.position.y += body.velocity.y; } if (body.angularVelocity !== 0) { Vertices.rotate(part.vertices, body.angularVelocity, body.position); Axes.rotate(part.axes, body.angularVelocity); if (i > 0) { Vector.rotateAbout(part.position, body.angularVelocity, body.position, part.position); } } Bounds.update(part.bounds, part.vertices, body.velocity); } }; /** * Applies a force to a body from a given world-space position, including resulting torque. * @method applyForce * @param {body} body * @param {vector} position * @param {vector} force */ Body.applyForce = function(body, position, force) { body.force.x += force.x; body.force.y += force.y; var offset = { x: position.x - body.position.x, y: position.y - body.position.y }; body.torque += offset.x * force.y - offset.y * force.x; }; /** * Returns the sums of the properties of all compound parts of the parent body. * @method _totalProperties * @private * @param {body} body * @return {} */ var _totalProperties = function(body) { // https://ecourses.ou.edu/cgi-bin/ebook.cgi?doc=&topic=st&chap_sec=07.2&page=theory // http://output.to/sideway/default.asp?qno=121100087 var properties = { mass: 0, area: 0, inertia: 0, centre: { x: 0, y: 0 } }; // sum the properties of all compound parts of the parent body for (var i = body.parts.length === 1 ? 0 : 1; i < body.parts.length; i++) { var part = body.parts[i]; properties.mass += part.mass; properties.area += part.area; properties.inertia += part.inertia; properties.centre = Vector.add(properties.centre, Vector.mult(part.position, part.mass !== Infinity ? part.mass : 1)); } properties.centre = Vector.div(properties.centre, properties.mass !== Infinity ? properties.mass : body.parts.length); return properties; }; /* * * Events Documentation * */ /** * Fired when a body starts sleeping (where `this` is the body). * * @event sleepStart * @this {body} The body that has started sleeping * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a body ends sleeping (where `this` is the body). * * @event sleepEnd * @this {body} The body that has ended sleeping * @param {} event An event object * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Body.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "body" * @readOnly */ /** * An arbitrary `String` name to help the user identify and manage bodies. * * @property label * @type string * @default "Body" */ /** * An array of bodies that make up this body. * The first body in the array must always be a self reference to the current body instance. * All bodies in the `parts` array together form a single rigid compound body. * Parts are allowed to overlap, have gaps or holes or even form concave bodies. * Parts themselves should never be added to a `World`, only the parent body should be. * Use `Body.setParts` when setting parts to ensure correct updates of all properties. * * @property parts * @type body[] */ /** * A self reference if the body is _not_ a part of another body. * Otherwise this is a reference to the body that this is a part of. * See `body.parts`. * * @property parent * @type body */ /** * A `Number` specifying the angle of the body, in radians. * * @property angle * @type number * @default 0 */ /** * An array of `Vector` objects that specify the convex hull of the rigid body. * These should be provided about the origin `(0, 0)`. E.g. * * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] * * When passed via `Body.create`, the vertices are translated relative to `body.position` (i.e. world-space, and constantly updated by `Body.update` during simulation). * The `Vector` objects are also augmented with additional properties required for efficient collision detection. * * Other properties such as `inertia` and `bounds` are automatically calculated from the passed vertices (unless provided via `options`). * Concave hulls are not currently supported. The module `Matter.Vertices` contains useful methods for working with vertices. * * @property vertices * @type vector[] */ /** * A `Vector` that specifies the current world-space position of the body. * * @property position * @type vector * @default { x: 0, y: 0 } */ /** * A `Vector` that specifies the force to apply in the current step. It is zeroed after every `Body.update`. See also `Body.applyForce`. * * @property force * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that specifies the torque (turning force) to apply in the current step. It is zeroed after every `Body.update`. * * @property torque * @type number * @default 0 */ /** * A `Number` that _measures_ the current speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.velocity`). * * @readOnly * @property speed * @type number * @default 0 */ /** * A `Number` that _measures_ the current angular speed of the body after the last `Body.update`. It is read-only and always positive (it's the magnitude of `body.angularVelocity`). * * @readOnly * @property angularSpeed * @type number * @default 0 */ /** * A `Vector` that _measures_ the current velocity of the body after the last `Body.update`. It is read-only. * If you need to modify a body's velocity directly, you should either apply a force or simply change the body's `position` (as the engine uses position-Verlet integration). * * @readOnly * @property velocity * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that _measures_ the current angular velocity of the body after the last `Body.update`. It is read-only. * If you need to modify a body's angular velocity directly, you should apply a torque or simply change the body's `angle` (as the engine uses position-Verlet integration). * * @readOnly * @property angularVelocity * @type number * @default 0 */ /** * A flag that indicates whether a body is considered static. A static body can never change position or angle and is completely fixed. * If you need to set a body as static after its creation, you should use `Body.setStatic` as this requires more than just setting this flag. * * @property isStatic * @type boolean * @default false */ /** * A flag that indicates whether a body is a sensor. Sensor triggers collision events, but doesn't react with colliding body physically. * * @property isSensor * @type boolean * @default false */ /** * A flag that indicates whether the body is considered sleeping. A sleeping body acts similar to a static body, except it is only temporary and can be awoken. * If you need to set a body as sleeping, you should use `Sleeping.set` as this requires more than just setting this flag. * * @property isSleeping * @type boolean * @default false */ /** * A `Number` that _measures_ the amount of movement a body currently has (a combination of `speed` and `angularSpeed`). It is read-only and always positive. * It is used and updated by the `Matter.Sleeping` module during simulation to decide if a body has come to rest. * * @readOnly * @property motion * @type number * @default 0 */ /** * A `Number` that defines the number of updates in which this body must have near-zero velocity before it is set as sleeping by the `Matter.Sleeping` module (if sleeping is enabled by the engine). * * @property sleepThreshold * @type number * @default 60 */ /** * A `Number` that defines the density of the body, that is its mass per unit area. * If you pass the density via `Body.create` the `mass` property is automatically calculated for you based on the size (area) of the object. * This is generally preferable to simply setting mass and allows for more intuitive definition of materials (e.g. rock has a higher density than wood). * * @property density * @type number * @default 0.001 */ /** * A `Number` that defines the mass of the body, although it may be more appropriate to specify the `density` property instead. * If you modify this value, you must also modify the `body.inverseMass` property (`1 / mass`). * * @property mass * @type number */ /** * A `Number` that defines the inverse mass of the body (`1 / mass`). * If you modify this value, you must also modify the `body.mass` property. * * @property inverseMass * @type number */ /** * A `Number` that defines the moment of inertia (i.e. second moment of area) of the body. * It is automatically calculated from the given convex hull (`vertices` array) and density in `Body.create`. * If you modify this value, you must also modify the `body.inverseInertia` property (`1 / inertia`). * * @property inertia * @type number */ /** * A `Number` that defines the inverse moment of inertia of the body (`1 / inertia`). * If you modify this value, you must also modify the `body.inertia` property. * * @property inverseInertia * @type number */ /** * A `Number` that defines the restitution (elasticity) of the body. The value is always positive and is in the range `(0, 1)`. * A value of `0` means collisions may be perfectly inelastic and no bouncing may occur. * A value of `0.8` means the body may bounce back with approximately 80% of its kinetic energy. * Note that collision response is based on _pairs_ of bodies, and that `restitution` values are _combined_ with the following formula: * * Math.max(bodyA.restitution, bodyB.restitution) * * @property restitution * @type number * @default 0 */ /** * A `Number` that defines the friction of the body. The value is always positive and is in the range `(0, 1)`. * A value of `0` means that the body may slide indefinitely. * A value of `1` means the body may come to a stop almost instantly after a force is applied. * * The effects of the value may be non-linear. * High values may be unstable depending on the body. * The engine uses a Coulomb friction model including static and kinetic friction. * Note that collision response is based on _pairs_ of bodies, and that `friction` values are _combined_ with the following formula: * * Math.min(bodyA.friction, bodyB.friction) * * @property friction * @type number * @default 0.1 */ /** * A `Number` that defines the static friction of the body (in the Coulomb friction model). * A value of `0` means the body will never 'stick' when it is nearly stationary and only dynamic `friction` is used. * The higher the value (e.g. `10`), the more force it will take to initially get the body moving when nearly stationary. * This value is multiplied with the `friction` property to make it easier to change `friction` and maintain an appropriate amount of static friction. * * @property frictionStatic * @type number * @default 0.5 */ /** * A `Number` that defines the air friction of the body (air resistance). * A value of `0` means the body will never slow as it moves through space. * The higher the value, the faster a body slows when moving through space. * The effects of the value are non-linear. * * @property frictionAir * @type number * @default 0.01 */ /** * An `Object` that specifies the collision filtering properties of this body. * * Collisions between two bodies will obey the following rules: * - If the two bodies have the same non-zero value of `collisionFilter.group`, * they will always collide if the value is positive, and they will never collide * if the value is negative. * - If the two bodies have different values of `collisionFilter.group` or if one * (or both) of the bodies has a value of 0, then the category/mask rules apply as follows: * * Each body belongs to a collision category, given by `collisionFilter.category`. This * value is used as a bit field and the category should have only one bit set, meaning that * the value of this property is a power of two in the range [1, 2^31]. Thus, there are 32 * different collision categories available. * * Each body also defines a collision bitmask, given by `collisionFilter.mask` which specifies * the categories it collides with (the value is the bitwise AND value of all these categories). * * Using the category/mask rules, two bodies `A` and `B` collide if each includes the other's * category in its mask, i.e. `(categoryA & maskB) !== 0` and `(categoryB & maskA) !== 0` * are both true. * * @property collisionFilter * @type object */ /** * An Integer `Number`, that specifies the collision group this body belongs to. * See `body.collisionFilter` for more information. * * @property collisionFilter.group * @type object * @default 0 */ /** * A bit field that specifies the collision category this body belongs to. * The category value should have only one bit set, for example `0x0001`. * This means there are up to 32 unique collision categories available. * See `body.collisionFilter` for more information. * * @property collisionFilter.category * @type object * @default 1 */ /** * A bit mask that specifies the collision categories this body may collide with. * See `body.collisionFilter` for more information. * * @property collisionFilter.mask * @type object * @default -1 */ /** * A `Number` that specifies a tolerance on how far a body is allowed to 'sink' or rotate into other bodies. * Avoid changing this value unless you understand the purpose of `slop` in physics engines. * The default should generally suffice, although very large bodies may require larger values for stable stacking. * * @property slop * @type number * @default 0.05 */ /** * A `Number` that allows per-body time scaling, e.g. a force-field where bodies inside are in slow-motion, while others are at full speed. * * @property timeScale * @type number * @default 1 */ /** * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`. * * @property render * @type object */ /** * A flag that indicates if the body should be rendered. * * @property render.visible * @type boolean * @default true */ /** * Sets the opacity to use when rendering. * * @property render.opacity * @type number * @default 1 */ /** * An `Object` that defines the sprite properties to use when rendering, if any. * * @property render.sprite * @type object */ /** * An `String` that defines the path to the image to use as the sprite texture, if any. * * @property render.sprite.texture * @type string */ /** * A `Number` that defines the scaling in the x-axis for the sprite, if any. * * @property render.sprite.xScale * @type number * @default 1 */ /** * A `Number` that defines the scaling in the y-axis for the sprite, if any. * * @property render.sprite.yScale * @type number * @default 1 */ /** * A `Number` that defines the offset in the x-axis for the sprite (normalised by texture width). * * @property render.sprite.xOffset * @type number * @default 0 */ /** * A `Number` that defines the offset in the y-axis for the sprite (normalised by texture height). * * @property render.sprite.yOffset * @type number * @default 0 */ /** * A `Number` that defines the line width to use when rendering the body outline (if a sprite is not defined). * A value of `0` means no outline will be rendered. * * @property render.lineWidth * @type number * @default 1.5 */ /** * A `String` that defines the fill style to use when rendering the body (if a sprite is not defined). * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.fillStyle * @type string * @default a random colour */ /** * A `String` that defines the stroke style to use when rendering the body outline (if a sprite is not defined). * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.strokeStyle * @type string * @default a random colour */ /** * An array of unique axis vectors (edge normals) used for collision detection. * These are automatically calculated from the given convex hull (`vertices` array) in `Body.create`. * They are constantly updated by `Body.update` during the simulation. * * @property axes * @type vector[] */ /** * A `Number` that _measures_ the area of the body's convex hull, calculated at creation by `Body.create`. * * @property area * @type string * @default */ /** * A `Bounds` object that defines the AABB region for the body. * It is automatically calculated from the given convex hull (`vertices` array) in `Body.create` and constantly updated by `Body.update` during simulation. * * @property bounds * @type bounds */ })(); },{"../core/Common":14,"../core/Sleeping":20,"../geometry/Axes":23,"../geometry/Bounds":24,"../geometry/Vector":26,"../geometry/Vertices":27,"../render/Render":29}],2:[function(require,module,exports){ /** * The `Matter.Composite` module contains methods for creating and manipulating composite bodies. * A composite body is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`, therefore composites form a tree structure. * It is important to use the functions in this module to modify composites, rather than directly modifying their properties. * Note that the `Matter.World` object is also a type of `Matter.Composite` and as such all composite methods here can also operate on a `Matter.World`. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Composite */ var Composite = {}; module.exports = Composite; var Events = require('../core/Events'); var Common = require('../core/Common'); var Body = require('./Body'); (function() { /** * Creates a new composite. The options parameter is an object that specifies any properties you wish to override the defaults. * See the properites section below for detailed information on what you can pass via the `options` object. * @method create * @param {} [options] * @return {composite} A new composite */ Composite.create = function(options) { return Common.extend({ id: Common.nextId(), type: 'composite', parent: null, isModified: false, bodies: [], constraints: [], composites: [], label: 'Composite' }, options); }; /** * Sets the composite's `isModified` flag. * If `updateParents` is true, all parents will be set (default: false). * If `updateChildren` is true, all children will be set (default: false). * @method setModified * @param {composite} composite * @param {boolean} isModified * @param {boolean} [updateParents=false] * @param {boolean} [updateChildren=false] */ Composite.setModified = function(composite, isModified, updateParents, updateChildren) { composite.isModified = isModified; if (updateParents && composite.parent) { Composite.setModified(composite.parent, isModified, updateParents, updateChildren); } if (updateChildren) { for(var i = 0; i < composite.composites.length; i++) { var childComposite = composite.composites[i]; Composite.setModified(childComposite, isModified, updateParents, updateChildren); } } }; /** * Generic add function. Adds one or many body(s), constraint(s) or a composite(s) to the given composite. * Triggers `beforeAdd` and `afterAdd` events on the `composite`. * @method add * @param {composite} composite * @param {} object * @return {composite} The original composite with the objects added */ Composite.add = function(composite, object) { var objects = [].concat(object); Events.trigger(composite, 'beforeAdd', { object: object }); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': // skip adding compound parts if (obj.parent !== obj) { Common.log('Composite.add: skipped adding a compound body part (you must add its parent instead)', 'warn'); break; } Composite.addBody(composite, obj); break; case 'constraint': Composite.addConstraint(composite, obj); break; case 'composite': Composite.addComposite(composite, obj); break; case 'mouseConstraint': Composite.addConstraint(composite, obj.constraint); break; } } Events.trigger(composite, 'afterAdd', { object: object }); return composite; }; /** * Generic remove function. Removes one or many body(s), constraint(s) or a composite(s) to the given composite. * Optionally searching its children recursively. * Triggers `beforeRemove` and `afterRemove` events on the `composite`. * @method remove * @param {composite} composite * @param {} object * @param {boolean} [deep=false] * @return {composite} The original composite with the objects removed */ Composite.remove = function(composite, object, deep) { var objects = [].concat(object); Events.trigger(composite, 'beforeRemove', { object: object }); for (var i = 0; i < objects.length; i++) { var obj = objects[i]; switch (obj.type) { case 'body': Composite.removeBody(composite, obj, deep); break; case 'constraint': Composite.removeConstraint(composite, obj, deep); break; case 'composite': Composite.removeComposite(composite, obj, deep); break; case 'mouseConstraint': Composite.removeConstraint(composite, obj.constraint); break; } } Events.trigger(composite, 'afterRemove', { object: object }); return composite; }; /** * Adds a composite to the given composite. * @private * @method addComposite * @param {composite} compositeA * @param {composite} compositeB * @return {composite} The original compositeA with the objects from compositeB added */ Composite.addComposite = function(compositeA, compositeB) { compositeA.composites.push(compositeB); compositeB.parent = compositeA; Composite.setModified(compositeA, true, true, false); return compositeA; }; /** * Removes a composite from the given composite, and optionally searching its children recursively. * @private * @method removeComposite * @param {composite} compositeA * @param {composite} compositeB * @param {boolean} [deep=false] * @return {composite} The original compositeA with the composite removed */ Composite.removeComposite = function(compositeA, compositeB, deep) { var position = Common.indexOf(compositeA.composites, compositeB); if (position !== -1) { Composite.removeCompositeAt(compositeA, position); Composite.setModified(compositeA, true, true, false); } if (deep) { for (var i = 0; i < compositeA.composites.length; i++){ Composite.removeComposite(compositeA.composites[i], compositeB, true); } } return compositeA; }; /** * Removes a composite from the given composite. * @private * @method removeCompositeAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the composite removed */ Composite.removeCompositeAt = function(composite, position) { composite.composites.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Adds a body to the given composite. * @private * @method addBody * @param {composite} composite * @param {body} body * @return {composite} The original composite with the body added */ Composite.addBody = function(composite, body) { composite.bodies.push(body); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a body from the given composite, and optionally searching its children recursively. * @private * @method removeBody * @param {composite} composite * @param {body} body * @param {boolean} [deep=false] * @return {composite} The original composite with the body removed */ Composite.removeBody = function(composite, body, deep) { var position = Common.indexOf(composite.bodies, body); if (position !== -1) { Composite.removeBodyAt(composite, position); Composite.setModified(composite, true, true, false); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeBody(composite.composites[i], body, true); } } return composite; }; /** * Removes a body from the given composite. * @private * @method removeBodyAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the body removed */ Composite.removeBodyAt = function(composite, position) { composite.bodies.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Adds a constraint to the given composite. * @private * @method addConstraint * @param {composite} composite * @param {constraint} constraint * @return {composite} The original composite with the constraint added */ Composite.addConstraint = function(composite, constraint) { composite.constraints.push(constraint); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes a constraint from the given composite, and optionally searching its children recursively. * @private * @method removeConstraint * @param {composite} composite * @param {constraint} constraint * @param {boolean} [deep=false] * @return {composite} The original composite with the constraint removed */ Composite.removeConstraint = function(composite, constraint, deep) { var position = Common.indexOf(composite.constraints, constraint); if (position !== -1) { Composite.removeConstraintAt(composite, position); } if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.removeConstraint(composite.composites[i], constraint, true); } } return composite; }; /** * Removes a body from the given composite. * @private * @method removeConstraintAt * @param {composite} composite * @param {number} position * @return {composite} The original composite with the constraint removed */ Composite.removeConstraintAt = function(composite, position) { composite.constraints.splice(position, 1); Composite.setModified(composite, true, true, false); return composite; }; /** * Removes all bodies, constraints and composites from the given composite. * Optionally clearing its children recursively. * @method clear * @param {composite} composite * @param {boolean} keepStatic * @param {boolean} [deep=false] */ Composite.clear = function(composite, keepStatic, deep) { if (deep) { for (var i = 0; i < composite.composites.length; i++){ Composite.clear(composite.composites[i], keepStatic, true); } } if (keepStatic) { composite.bodies = composite.bodies.filter(function(body) { return body.isStatic; }); } else { composite.bodies.length = 0; } composite.constraints.length = 0; composite.composites.length = 0; Composite.setModified(composite, true, true, false); return composite; }; /** * Returns all bodies in the given composite, including all bodies in its children, recursively. * @method allBodies * @param {composite} composite * @return {body[]} All the bodies */ Composite.allBodies = function(composite) { var bodies = [].concat(composite.bodies); for (var i = 0; i < composite.composites.length; i++) bodies = bodies.concat(Composite.allBodies(composite.composites[i])); return bodies; }; /** * Returns all constraints in the given composite, including all constraints in its children, recursively. * @method allConstraints * @param {composite} composite * @return {constraint[]} All the constraints */ Composite.allConstraints = function(composite) { var constraints = [].concat(composite.constraints); for (var i = 0; i < composite.composites.length; i++) constraints = constraints.concat(Composite.allConstraints(composite.composites[i])); return constraints; }; /** * Returns all composites in the given composite, including all composites in its children, recursively. * @method allComposites * @param {composite} composite * @return {composite[]} All the composites */ Composite.allComposites = function(composite) { var composites = [].concat(composite.composites); for (var i = 0; i < composite.composites.length; i++) composites = composites.concat(Composite.allComposites(composite.composites[i])); return composites; }; /** * Searches the composite recursively for an object matching the type and id supplied, null if not found. * @method get * @param {composite} composite * @param {number} id * @param {string} type * @return {object} The requested object, if found */ Composite.get = function(composite, id, type) { var objects, object; switch (type) { case 'body': objects = Composite.allBodies(composite); break; case 'constraint': objects = Composite.allConstraints(composite); break; case 'composite': objects = Composite.allComposites(composite).concat(composite); break; } if (!objects) return null; object = objects.filter(function(object) { return object.id.toString() === id.toString(); }); return object.length === 0 ? null : object[0]; }; /** * Moves the given object(s) from compositeA to compositeB (equal to a remove followed by an add). * @method move * @param {compositeA} compositeA * @param {object[]} objects * @param {compositeB} compositeB * @return {composite} Returns compositeA */ Composite.move = function(compositeA, objects, compositeB) { Composite.remove(compositeA, objects); Composite.add(compositeB, objects); return compositeA; }; /** * Assigns new ids for all objects in the composite, recursively. * @method rebase * @param {composite} composite * @return {composite} Returns composite */ Composite.rebase = function(composite) { var objects = Composite.allBodies(composite) .concat(Composite.allConstraints(composite)) .concat(Composite.allComposites(composite)); for (var i = 0; i < objects.length; i++) { objects[i].id = Common.nextId(); } Composite.setModified(composite, true, true, false); return composite; }; /** * Translates all children in the composite by a given vector relative to their current positions, * without imparting any velocity. * @method translate * @param {composite} composite * @param {vector} translation * @param {bool} [recursive=true] */ Composite.translate = function(composite, translation, recursive) { var bodies = recursive ? Composite.allBodies(composite) : composite.bodies; for (var i = 0; i < bodies.length; i++) { Body.translate(bodies[i], translation); } Composite.setModified(composite, true, true, false); return composite; }; /** * Rotates all children in the composite by a given angle about the given point, without imparting any angular velocity. * @method rotate * @param {composite} composite * @param {number} rotation * @param {vector} point * @param {bool} [recursive=true] */ Composite.rotate = function(composite, rotation, point, recursive) { var cos = Math.cos(rotation), sin = Math.sin(rotation), bodies = recursive ? Composite.allBodies(composite) : composite.bodies; for (var i = 0; i < bodies.length; i++) { var body = bodies[i], dx = body.position.x - point.x, dy = body.position.y - point.y; Body.setPosition(body, { x: point.x + (dx * cos - dy * sin), y: point.y + (dx * sin + dy * cos) }); Body.rotate(body, rotation); } Composite.setModified(composite, true, true, false); return composite; }; /** * Scales all children in the composite, including updating physical properties (mass, area, axes, inertia), from a world-space point. * @method scale * @param {composite} composite * @param {number} scaleX * @param {number} scaleY * @param {vector} point * @param {bool} [recursive=true] */ Composite.scale = function(composite, scaleX, scaleY, point, recursive) { var bodies = recursive ? Composite.allBodies(composite) : composite.bodies; for (var i = 0; i < bodies.length; i++) { var body = bodies[i], dx = body.position.x - point.x, dy = body.position.y - point.y; Body.setPosition(body, { x: point.x + dx * scaleX, y: point.y + dy * scaleY }); Body.scale(body, scaleX, scaleY); } Composite.setModified(composite, true, true, false); return composite; }; /* * * Events Documentation * */ /** * Fired when a call to `Composite.add` is made, before objects have been added. * * @event beforeAdd * @param {} event An event object * @param {} event.object The object(s) to be added (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.add` is made, after objects have been added. * * @event afterAdd * @param {} event An event object * @param {} event.object The object(s) that have been added (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.remove` is made, before objects have been removed. * * @event beforeRemove * @param {} event An event object * @param {} event.object The object(s) to be removed (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when a call to `Composite.remove` is made, after objects have been removed. * * @event afterRemove * @param {} event An event object * @param {} event.object The object(s) that have been removed (may be a single body, constraint, composite or a mixed array of these) * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "composite" * @readOnly */ /** * An arbitrary `String` name to help the user identify and manage composites. * * @property label * @type string * @default "Composite" */ /** * A flag that specifies whether the composite has been modified during the current step. * Most `Matter.Composite` methods will automatically set this flag to `true` to inform the engine of changes to be handled. * If you need to change it manually, you should use the `Composite.setModified` method. * * @property isModified * @type boolean * @default false */ /** * The `Composite` that is the parent of this composite. It is automatically managed by the `Matter.Composite` methods. * * @property parent * @type composite * @default null */ /** * An array of `Body` that are _direct_ children of this composite. * To add or remove bodies you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allBodies` method. * * @property bodies * @type body[] * @default [] */ /** * An array of `Constraint` that are _direct_ children of this composite. * To add or remove constraints you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allConstraints` method. * * @property constraints * @type constraint[] * @default [] */ /** * An array of `Composite` that are _direct_ children of this composite. * To add or remove composites you should use `Composite.add` and `Composite.remove` methods rather than directly modifying this property. * If you wish to recursively find all descendants, you should use the `Composite.allComposites` method. * * @property composites * @type composite[] * @default [] */ })(); },{"../core/Common":14,"../core/Events":16,"./Body":1}],3:[function(require,module,exports){ /** * The `Matter.World` module contains methods for creating and manipulating the world composite. * A `Matter.World` is a `Matter.Composite` body, which is a collection of `Matter.Body`, `Matter.Constraint` and other `Matter.Composite`. * A `Matter.World` has a few additional properties including `gravity` and `bounds`. * It is important to use the functions in the `Matter.Composite` module to modify the world composite, rather than directly modifying its properties. * There are also a few methods here that alias those in `Matter.Composite` for easier readability. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class World * @extends Composite */ var World = {}; module.exports = World; var Composite = require('./Composite'); var Constraint = require('../constraint/Constraint'); var Common = require('../core/Common'); (function() { /** * Creates a new world composite. The options parameter is an object that specifies any properties you wish to override the defaults. * See the properties section below for detailed information on what you can pass via the `options` object. * @method create * @constructor * @param {} options * @return {world} A new world */ World.create = function(options) { var composite = Composite.create(); var defaults = { label: 'World', gravity: { x: 0, y: 1, scale: 0.001 }, bounds: { min: { x: -Infinity, y: -Infinity }, max: { x: Infinity, y: Infinity } } }; return Common.extend(composite, defaults, options); }; /* * * Properties Documentation * */ /** * The gravity to apply on the world. * * @property gravity * @type object */ /** * The gravity x component. * * @property gravity.x * @type object * @default 0 */ /** * The gravity y component. * * @property gravity.y * @type object * @default 1 */ /** * The gravity scale factor. * * @property gravity.scale * @type object * @default 0.001 */ /** * A `Bounds` object that defines the world bounds for collision detection. * * @property bounds * @type bounds * @default { min: { x: -Infinity, y: -Infinity }, max: { x: Infinity, y: Infinity } } */ // World is a Composite body // see src/module/Outro.js for these aliases: /** * An alias for Composite.clear * @method clear * @param {world} world * @param {boolean} keepStatic */ /** * An alias for Composite.add * @method addComposite * @param {world} world * @param {composite} composite * @return {world} The original world with the objects from composite added */ /** * An alias for Composite.addBody * @method addBody * @param {world} world * @param {body} body * @return {world} The original world with the body added */ /** * An alias for Composite.addConstraint * @method addConstraint * @param {world} world * @param {constraint} constraint * @return {world} The original world with the constraint added */ })(); },{"../constraint/Constraint":12,"../core/Common":14,"./Composite":2}],4:[function(require,module,exports){ /** * The `Matter.Contact` module contains methods for creating and manipulating collision contacts. * * @class Contact */ var Contact = {}; module.exports = Contact; (function() { /** * Creates a new contact. * @method create * @param {vertex} vertex * @return {contact} A new contact */ Contact.create = function(vertex) { return { id: Contact.id(vertex), vertex: vertex, normalImpulse: 0, tangentImpulse: 0 }; }; /** * Generates a contact id. * @method id * @param {vertex} vertex * @return {string} Unique contactID */ Contact.id = function(vertex) { return vertex.body.id + '_' + vertex.index; }; })(); },{}],5:[function(require,module,exports){ /** * The `Matter.Detector` module contains methods for detecting collisions given a set of pairs. * * @class Detector */ // TODO: speculative contacts var Detector = {}; module.exports = Detector; var SAT = require('./SAT'); var Pair = require('./Pair'); var Bounds = require('../geometry/Bounds'); (function() { /** * Finds all collisions given a list of pairs. * @method collisions * @param {pair[]} broadphasePairs * @param {engine} engine * @return {array} collisions */ Detector.collisions = function(broadphasePairs, engine) { var collisions = [], pairsTable = engine.pairs.table; for (var i = 0; i < broadphasePairs.length; i++) { var bodyA = broadphasePairs[i][0], bodyB = broadphasePairs[i][1]; if ((bodyA.isStatic || bodyA.isSleeping) && (bodyB.isStatic || bodyB.isSleeping)) continue; if (!Detector.canCollide(bodyA.collisionFilter, bodyB.collisionFilter)) continue; // mid phase if (Bounds.overlaps(bodyA.bounds, bodyB.bounds)) { for (var j = bodyA.parts.length > 1 ? 1 : 0; j < bodyA.parts.length; j++) { var partA = bodyA.parts[j]; for (var k = bodyB.parts.length > 1 ? 1 : 0; k < bodyB.parts.length; k++) { var partB = bodyB.parts[k]; if ((partA === bodyA && partB === bodyB) || Bounds.overlaps(partA.bounds, partB.bounds)) { // find a previous collision we could reuse var pairId = Pair.id(partA, partB), pair = pairsTable[pairId], previousCollision; if (pair && pair.isActive) { previousCollision = pair.collision; } else { previousCollision = null; } // narrow phase var collision = SAT.collides(partA, partB, previousCollision); if (collision.collided) { collisions.push(collision); } } } } } } return collisions; }; /** * Returns `true` if both supplied collision filters will allow a collision to occur. * See `body.collisionFilter` for more information. * @method canCollide * @param {} filterA * @param {} filterB * @return {bool} `true` if collision can occur */ Detector.canCollide = function(filterA, filterB) { if (filterA.group === filterB.group && filterA.group !== 0) return filterA.group > 0; return (filterA.mask & filterB.category) !== 0 && (filterB.mask & filterA.category) !== 0; }; })(); },{"../geometry/Bounds":24,"./Pair":7,"./SAT":11}],6:[function(require,module,exports){ /** * The `Matter.Grid` module contains methods for creating and manipulating collision broadphase grid structures. * * @class Grid */ var Grid = {}; module.exports = Grid; var Pair = require('./Pair'); var Detector = require('./Detector'); var Common = require('../core/Common'); (function() { /** * Creates a new grid. * @method create * @param {} options * @return {grid} A new grid */ Grid.create = function(options) { var defaults = { controller: Grid, detector: Detector.collisions, buckets: {}, pairs: {}, pairsList: [], bucketWidth: 48, bucketHeight: 48 }; return Common.extend(defaults, options); }; /** * The width of a single grid bucket. * * @property bucketWidth * @type number * @default 48 */ /** * The height of a single grid bucket. * * @property bucketHeight * @type number * @default 48 */ /** * Updates the grid. * @method update * @param {grid} grid * @param {body[]} bodies * @param {engine} engine * @param {boolean} forceUpdate */ Grid.update = function(grid, bodies, engine, forceUpdate) { var i, col, row, world = engine.world, buckets = grid.buckets, bucket, bucketId, gridChanged = false; for (i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isSleeping && !forceUpdate) continue; // don't update out of world bodies if (body.bounds.max.x < world.bounds.min.x || body.bounds.min.x > world.bounds.max.x || body.bounds.max.y < world.bounds.min.y || body.bounds.min.y > world.bounds.max.y) continue; var newRegion = _getRegion(grid, body); // if the body has changed grid region if (!body.region || newRegion.id !== body.region.id || forceUpdate) { if (!body.region || forceUpdate) body.region = newRegion; var union = _regionUnion(newRegion, body.region); // update grid buckets affected by region change // iterate over the union of both regions for (col = union.startCol; col <= union.endCol; col++) { for (row = union.startRow; row <= union.endRow; row++) { bucketId = _getBucketId(col, row); bucket = buckets[bucketId]; var isInsideNewRegion = (col >= newRegion.startCol && col <= newRegion.endCol && row >= newRegion.startRow && row <= newRegion.endRow); var isInsideOldRegion = (col >= body.region.startCol && col <= body.region.endCol && row >= body.region.startRow && row <= body.region.endRow); // remove from old region buckets if (!isInsideNewRegion && isInsideOldRegion) { if (isInsideOldRegion) { if (bucket) _bucketRemoveBody(grid, bucket, body); } } // add to new region buckets if (body.region === newRegion || (isInsideNewRegion && !isInsideOldRegion) || forceUpdate) { if (!bucket) bucket = _createBucket(buckets, bucketId); _bucketAddBody(grid, bucket, body); } } } // set the new region body.region = newRegion; // flag changes so we can update pairs gridChanged = true; } } // update pairs list only if pairs changed (i.e. a body changed region) if (gridChanged) grid.pairsList = _createActivePairsList(grid); }; /** * Clears the grid. * @method clear * @param {grid} grid */ Grid.clear = function(grid) { grid.buckets = {}; grid.pairs = {}; grid.pairsList = []; }; /** * Finds the union of two regions. * @method _regionUnion * @private * @param {} regionA * @param {} regionB * @return {} region */ var _regionUnion = function(regionA, regionB) { var startCol = Math.min(regionA.startCol, regionB.startCol), endCol = Math.max(regionA.endCol, regionB.endCol), startRow = Math.min(regionA.startRow, regionB.startRow), endRow = Math.max(regionA.endRow, regionB.endRow); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Gets the region a given body falls in for a given grid. * @method _getRegion * @private * @param {} grid * @param {} body * @return {} region */ var _getRegion = function(grid, body) { var bounds = body.bounds, startCol = Math.floor(bounds.min.x / grid.bucketWidth), endCol = Math.floor(bounds.max.x / grid.bucketWidth), startRow = Math.floor(bounds.min.y / grid.bucketHeight), endRow = Math.floor(bounds.max.y / grid.bucketHeight); return _createRegion(startCol, endCol, startRow, endRow); }; /** * Creates a region. * @method _createRegion * @private * @param {} startCol * @param {} endCol * @param {} startRow * @param {} endRow * @return {} region */ var _createRegion = function(startCol, endCol, startRow, endRow) { return { id: startCol + ',' + endCol + ',' + startRow + ',' + endRow, startCol: startCol, endCol: endCol, startRow: startRow, endRow: endRow }; }; /** * Gets the bucket id at the given position. * @method _getBucketId * @private * @param {} column * @param {} row * @return {string} bucket id */ var _getBucketId = function(column, row) { return column + ',' + row; }; /** * Creates a bucket. * @method _createBucket * @private * @param {} buckets * @param {} bucketId * @return {} bucket */ var _createBucket = function(buckets, bucketId) { var bucket = buckets[bucketId] = []; return bucket; }; /** * Adds a body to a bucket. * @method _bucketAddBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketAddBody = function(grid, bucket, body) { // add new pairs for (var i = 0; i < bucket.length; i++) { var bodyB = bucket[i]; if (body.id === bodyB.id || (body.isStatic && bodyB.isStatic)) continue; // keep track of the number of buckets the pair exists in // important for Grid.update to work var pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) { pair[2] += 1; } else { grid.pairs[pairId] = [body, bodyB, 1]; } } // add to bodies (after pairs, otherwise pairs with self) bucket.push(body); }; /** * Removes a body from a bucket. * @method _bucketRemoveBody * @private * @param {} grid * @param {} bucket * @param {} body */ var _bucketRemoveBody = function(grid, bucket, body) { // remove from bucket bucket.splice(Common.indexOf(bucket, body), 1); // update pair counts for (var i = 0; i < bucket.length; i++) { // keep track of the number of buckets the pair exists in // important for _createActivePairsList to work var bodyB = bucket[i], pairId = Pair.id(body, bodyB), pair = grid.pairs[pairId]; if (pair) pair[2] -= 1; } }; /** * Generates a list of the active pairs in the grid. * @method _createActivePairsList * @private * @param {} grid * @return [] pairs */ var _createActivePairsList = function(grid) { var pairKeys, pair, pairs = []; // grid.pairs is used as a hashmap pairKeys = Common.keys(grid.pairs); // iterate over grid.pairs for (var k = 0; k < pairKeys.length; k++) { pair = grid.pairs[pairKeys[k]]; // if pair exists in at least one bucket // it is a pair that needs further collision testing so push it if (pair[2] > 0) { pairs.push(pair); } else { delete grid.pairs[pairKeys[k]]; } } return pairs; }; })(); },{"../core/Common":14,"./Detector":5,"./Pair":7}],7:[function(require,module,exports){ /** * The `Matter.Pair` module contains methods for creating and manipulating collision pairs. * * @class Pair */ var Pair = {}; module.exports = Pair; var Contact = require('./Contact'); (function() { /** * Creates a pair. * @method create * @param {collision} collision * @param {number} timestamp * @return {pair} A new pair */ Pair.create = function(collision, timestamp) { var bodyA = collision.bodyA, bodyB = collision.bodyB, parentA = collision.parentA, parentB = collision.parentB; var pair = { id: Pair.id(bodyA, bodyB), bodyA: bodyA, bodyB: bodyB, contacts: {}, activeContacts: [], separation: 0, isActive: true, isSensor: bodyA.isSensor || bodyB.isSensor, timeCreated: timestamp, timeUpdated: timestamp, inverseMass: parentA.inverseMass + parentB.inverseMass, friction: Math.min(parentA.friction, parentB.friction), frictionStatic: Math.max(parentA.frictionStatic, parentB.frictionStatic), restitution: Math.max(parentA.restitution, parentB.restitution), slop: Math.max(parentA.slop, parentB.slop) }; Pair.update(pair, collision, timestamp); return pair; }; /** * Updates a pair given a collision. * @method update * @param {pair} pair * @param {collision} collision * @param {number} timestamp */ Pair.update = function(pair, collision, timestamp) { var contacts = pair.contacts, supports = collision.supports, activeContacts = pair.activeContacts, parentA = collision.parentA, parentB = collision.parentB; pair.collision = collision; pair.inverseMass = parentA.inverseMass + parentB.inverseMass; pair.friction = Math.min(parentA.friction, parentB.friction); pair.frictionStatic = Math.max(parentA.frictionStatic, parentB.frictionStatic); pair.restitution = Math.max(parentA.restitution, parentB.restitution); pair.slop = Math.max(parentA.slop, parentB.slop); activeContacts.length = 0; if (collision.collided) { for (var i = 0; i < supports.length; i++) { var support = supports[i], contactId = Contact.id(support), contact = contacts[contactId]; if (contact) { activeContacts.push(contact); } else { activeContacts.push(contacts[contactId] = Contact.create(support)); } } pair.separation = collision.depth; Pair.setActive(pair, true, timestamp); } else { if (pair.isActive === true) Pair.setActive(pair, false, timestamp); } }; /** * Set a pair as active or inactive. * @method setActive * @param {pair} pair * @param {bool} isActive * @param {number} timestamp */ Pair.setActive = function(pair, isActive, timestamp) { if (isActive) { pair.isActive = true; pair.timeUpdated = timestamp; } else { pair.isActive = false; pair.activeContacts.length = 0; } }; /** * Get the id for the given pair. * @method id * @param {body} bodyA * @param {body} bodyB * @return {string} Unique pairId */ Pair.id = function(bodyA, bodyB) { if (bodyA.id < bodyB.id) { return bodyA.id + '_' + bodyB.id; } else { return bodyB.id + '_' + bodyA.id; } }; })(); },{"./Contact":4}],8:[function(require,module,exports){ /** * The `Matter.Pairs` module contains methods for creating and manipulating collision pair sets. * * @class Pairs */ var Pairs = {}; module.exports = Pairs; var Pair = require('./Pair'); var Common = require('../core/Common'); (function() { var _pairMaxIdleLife = 1000; /** * Creates a new pairs structure. * @method create * @param {object} options * @return {pairs} A new pairs structure */ Pairs.create = function(options) { return Common.extend({ table: {}, list: [], collisionStart: [], collisionActive: [], collisionEnd: [] }, options); }; /** * Updates pairs given a list of collisions. * @method update * @param {object} pairs * @param {collision[]} collisions * @param {number} timestamp */ Pairs.update = function(pairs, collisions, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, collisionStart = pairs.collisionStart, collisionEnd = pairs.collisionEnd, collisionActive = pairs.collisionActive, activePairIds = [], collision, pairId, pair, i; // clear collision state arrays, but maintain old reference collisionStart.length = 0; collisionEnd.length = 0; collisionActive.length = 0; for (i = 0; i < collisions.length; i++) { collision = collisions[i]; if (collision.collided) { pairId = Pair.id(collision.bodyA, collision.bodyB); activePairIds.push(pairId); pair = pairsTable[pairId]; if (pair) { // pair already exists (but may or may not be active) if (pair.isActive) { // pair exists and is active collisionActive.push(pair); } else { // pair exists but was inactive, so a collision has just started again collisionStart.push(pair); } // update the pair Pair.update(pair, collision, timestamp); } else { // pair did not exist, create a new pair pair = Pair.create(collision, timestamp); pairsTable[pairId] = pair; // push the new pair collisionStart.push(pair); pairsList.push(pair); } } } // deactivate previously active pairs that are now inactive for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; if (pair.isActive && Common.indexOf(activePairIds, pair.id) === -1) { Pair.setActive(pair, false, timestamp); collisionEnd.push(pair); } } }; /** * Finds and removes pairs that have been inactive for a set amount of time. * @method removeOld * @param {object} pairs * @param {number} timestamp */ Pairs.removeOld = function(pairs, timestamp) { var pairsList = pairs.list, pairsTable = pairs.table, indexesToRemove = [], pair, collision, pairIndex, i; for (i = 0; i < pairsList.length; i++) { pair = pairsList[i]; collision = pair.collision; // never remove sleeping pairs if (collision.bodyA.isSleeping || collision.bodyB.isSleeping) { pair.timeUpdated = timestamp; continue; } // if pair is inactive for too long, mark it to be removed if (timestamp - pair.timeUpdated > _pairMaxIdleLife) { indexesToRemove.push(i); } } // remove marked pairs for (i = 0; i < indexesToRemove.length; i++) { pairIndex = indexesToRemove[i] - i; pair = pairsList[pairIndex]; delete pairsTable[pair.id]; pairsList.splice(pairIndex, 1); } }; /** * Clears the given pairs structure. * @method clear * @param {pairs} pairs * @return {pairs} pairs */ Pairs.clear = function(pairs) { pairs.table = {}; pairs.list.length = 0; pairs.collisionStart.length = 0; pairs.collisionActive.length = 0; pairs.collisionEnd.length = 0; return pairs; }; })(); },{"../core/Common":14,"./Pair":7}],9:[function(require,module,exports){ /** * The `Matter.Query` module contains methods for performing collision queries. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Query */ var Query = {}; module.exports = Query; var Vector = require('../geometry/Vector'); var SAT = require('./SAT'); var Bounds = require('../geometry/Bounds'); var Bodies = require('../factory/Bodies'); var Vertices = require('../geometry/Vertices'); (function() { /** * Casts a ray segment against a set of bodies and returns all collisions, ray width is optional. Intersection points are not provided. * @method ray * @param {body[]} bodies * @param {vector} startPoint * @param {vector} endPoint * @param {number} [rayWidth] * @return {object[]} Collisions */ Query.ray = function(bodies, startPoint, endPoint, rayWidth) { rayWidth = rayWidth || 1e-100; var rayAngle = Vector.angle(startPoint, endPoint), rayLength = Vector.magnitude(Vector.sub(startPoint, endPoint)), rayX = (endPoint.x + startPoint.x) * 0.5, rayY = (endPoint.y + startPoint.y) * 0.5, ray = Bodies.rectangle(rayX, rayY, rayLength, rayWidth, { angle: rayAngle }), collisions = []; for (var i = 0; i < bodies.length; i++) { var bodyA = bodies[i]; if (Bounds.overlaps(bodyA.bounds, ray.bounds)) { for (var j = bodyA.parts.length === 1 ? 0 : 1; j < bodyA.parts.length; j++) { var part = bodyA.parts[j]; if (Bounds.overlaps(part.bounds, ray.bounds)) { var collision = SAT.collides(part, ray); if (collision.collided) { collision.body = collision.bodyA = collision.bodyB = bodyA; collisions.push(collision); break; } } } } } return collisions; }; /** * Returns all bodies whose bounds are inside (or outside if set) the given set of bounds, from the given set of bodies. * @method region * @param {body[]} bodies * @param {bounds} bounds * @param {bool} [outside=false] * @return {body[]} The bodies matching the query */ Query.region = function(bodies, bounds, outside) { var result = []; for (var i = 0; i < bodies.length; i++) { var body = bodies[i], overlaps = Bounds.overlaps(body.bounds, bounds); if ((overlaps && !outside) || (!overlaps && outside)) result.push(body); } return result; }; /** * Returns all bodies whose vertices contain the given point, from the given set of bodies. * @method point * @param {body[]} bodies * @param {vector} point * @return {body[]} The bodies matching the query */ Query.point = function(bodies, point) { var result = []; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (Bounds.contains(body.bounds, point)) { for (var j = body.parts.length === 1 ? 0 : 1; j < body.parts.length; j++) { var part = body.parts[j]; if (Bounds.contains(part.bounds, point) && Vertices.contains(part.vertices, point)) { result.push(body); break; } } } } return result; }; })(); },{"../factory/Bodies":21,"../geometry/Bounds":24,"../geometry/Vector":26,"../geometry/Vertices":27,"./SAT":11}],10:[function(require,module,exports){ /** * The `Matter.Resolver` module contains methods for resolving collision pairs. * * @class Resolver */ var Resolver = {}; module.exports = Resolver; var Vertices = require('../geometry/Vertices'); var Vector = require('../geometry/Vector'); var Common = require('../core/Common'); var Bounds = require('../geometry/Bounds'); (function() { Resolver._restingThresh = 4; Resolver._restingThreshTangent = 6; Resolver._positionDampen = 0.9; Resolver._positionWarming = 0.8; Resolver._frictionNormalMultiplier = 5; /** * Prepare pairs for position solving. * @method preSolvePosition * @param {pair[]} pairs */ Resolver.preSolvePosition = function(pairs) { var i, pair, activeCount; // find total contacts on each body for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; activeCount = pair.activeContacts.length; pair.collision.parentA.totalContacts += activeCount; pair.collision.parentB.totalContacts += activeCount; } }; /** * Find a solution for pair positions. * @method solvePosition * @param {pair[]} pairs * @param {number} timeScale */ Resolver.solvePosition = function(pairs, timeScale) { var i, pair, collision, bodyA, bodyB, normal, bodyBtoA, contactShare, positionImpulse, contactCount = {}, tempA = Vector._temp[0], tempB = Vector._temp[1], tempC = Vector._temp[2], tempD = Vector._temp[3]; // find impulses required to resolve penetration for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive || pair.isSensor) continue; collision = pair.collision; bodyA = collision.parentA; bodyB = collision.parentB; normal = collision.normal; // get current separation between body edges involved in collision bodyBtoA = Vector.sub(Vector.add(bodyB.positionImpulse, bodyB.position, tempA), Vector.add(bodyA.positionImpulse, Vector.sub(bodyB.position, collision.penetration, tempB), tempC), tempD); pair.separation = Vector.dot(normal, bodyBtoA); } for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive || pair.isSensor || pair.separation < 0) continue; collision = pair.collision; bodyA = collision.parentA; bodyB = collision.parentB; normal = collision.normal; positionImpulse = (pair.separation - pair.slop) * timeScale; if (bodyA.isStatic || bodyB.isStatic) positionImpulse *= 2; if (!(bodyA.isStatic || bodyA.isSleeping)) { contactShare = Resolver._positionDampen / bodyA.totalContacts; bodyA.positionImpulse.x += normal.x * positionImpulse * contactShare; bodyA.positionImpulse.y += normal.y * positionImpulse * contactShare; } if (!(bodyB.isStatic || bodyB.isSleeping)) { contactShare = Resolver._positionDampen / bodyB.totalContacts; bodyB.positionImpulse.x -= normal.x * positionImpulse * contactShare; bodyB.positionImpulse.y -= normal.y * positionImpulse * contactShare; } } }; /** * Apply position resolution. * @method postSolvePosition * @param {body[]} bodies */ Resolver.postSolvePosition = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; // reset contact count body.totalContacts = 0; if (body.positionImpulse.x !== 0 || body.positionImpulse.y !== 0) { // update body geometry for (var j = 0; j < body.parts.length; j++) { var part = body.parts[j]; Vertices.translate(part.vertices, body.positionImpulse); Bounds.update(part.bounds, part.vertices, body.velocity); part.position.x += body.positionImpulse.x; part.position.y += body.positionImpulse.y; } // move the body without changing velocity body.positionPrev.x += body.positionImpulse.x; body.positionPrev.y += body.positionImpulse.y; if (Vector.dot(body.positionImpulse, body.velocity) < 0) { // reset cached impulse if the body has velocity along it body.positionImpulse.x = 0; body.positionImpulse.y = 0; } else { // warm the next iteration body.positionImpulse.x *= Resolver._positionWarming; body.positionImpulse.y *= Resolver._positionWarming; } } } }; /** * Prepare pairs for velocity solving. * @method preSolveVelocity * @param {pair[]} pairs */ Resolver.preSolveVelocity = function(pairs) { var i, j, pair, contacts, collision, bodyA, bodyB, normal, tangent, contact, contactVertex, normalImpulse, tangentImpulse, offset, impulse = Vector._temp[0], tempA = Vector._temp[1]; for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive || pair.isSensor) continue; contacts = pair.activeContacts; collision = pair.collision; bodyA = collision.parentA; bodyB = collision.parentB; normal = collision.normal; tangent = collision.tangent; // resolve each contact for (j = 0; j < contacts.length; j++) { contact = contacts[j]; contactVertex = contact.vertex; normalImpulse = contact.normalImpulse; tangentImpulse = contact.tangentImpulse; if (normalImpulse !== 0 || tangentImpulse !== 0) { // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { offset = Vector.sub(contactVertex, bodyA.position, tempA); bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offset, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { offset = Vector.sub(contactVertex, bodyB.position, tempA); bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offset, impulse) * bodyB.inverseInertia; } } } } }; /** * Find a solution for pair velocities. * @method solveVelocity * @param {pair[]} pairs * @param {number} timeScale */ Resolver.solveVelocity = function(pairs, timeScale) { var timeScaleSquared = timeScale * timeScale, impulse = Vector._temp[0], tempA = Vector._temp[1], tempB = Vector._temp[2], tempC = Vector._temp[3], tempD = Vector._temp[4], tempE = Vector._temp[5]; for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; if (!pair.isActive || pair.isSensor) continue; var collision = pair.collision, bodyA = collision.parentA, bodyB = collision.parentB, normal = collision.normal, tangent = collision.tangent, contacts = pair.activeContacts, contactShare = 1 / contacts.length; // update body velocities bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // resolve each contact for (var j = 0; j < contacts.length; j++) { var contact = contacts[j], contactVertex = contact.vertex, offsetA = Vector.sub(contactVertex, bodyA.position, tempA), offsetB = Vector.sub(contactVertex, bodyB.position, tempB), velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity), tempC), velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity), tempD), relativeVelocity = Vector.sub(velocityPointA, velocityPointB, tempE), normalVelocity = Vector.dot(normal, relativeVelocity); var tangentVelocity = Vector.dot(tangent, relativeVelocity), tangentSpeed = Math.abs(tangentVelocity), tangentVelocityDirection = Common.sign(tangentVelocity); // raw impulses var normalImpulse = (1 + pair.restitution) * normalVelocity, normalForce = Common.clamp(pair.separation + normalVelocity, 0, 1) * Resolver._frictionNormalMultiplier; // coulomb friction var tangentImpulse = tangentVelocity, maxFriction = Infinity; if (tangentSpeed > pair.friction * pair.frictionStatic * normalForce * timeScaleSquared) { maxFriction = tangentSpeed; tangentImpulse = Common.clamp( pair.friction * tangentVelocityDirection * timeScaleSquared, -maxFriction, maxFriction ); } // modify impulses accounting for mass, inertia and offset var oAcN = Vector.cross(offsetA, normal), oBcN = Vector.cross(offsetB, normal), share = contactShare / (bodyA.inverseMass + bodyB.inverseMass + bodyA.inverseInertia * oAcN * oAcN + bodyB.inverseInertia * oBcN * oBcN); normalImpulse *= share; tangentImpulse *= share; // handle high velocity and resting collisions separately if (normalVelocity < 0 && normalVelocity * normalVelocity > Resolver._restingThresh * timeScaleSquared) { // high normal velocity so clear cached contact normal impulse contact.normalImpulse = 0; } else { // solve resting collision constraints using Erin Catto's method (GDC08) // impulse constraint tends to 0 var contactNormalImpulse = contact.normalImpulse; contact.normalImpulse = Math.min(contact.normalImpulse + normalImpulse, 0); normalImpulse = contact.normalImpulse - contactNormalImpulse; } // handle high velocity and resting collisions separately if (tangentVelocity * tangentVelocity > Resolver._restingThreshTangent * timeScaleSquared) { // high tangent velocity so clear cached contact tangent impulse contact.tangentImpulse = 0; } else { // solve resting collision constraints using Erin Catto's method (GDC08) // tangent impulse tends to -tangentSpeed or +tangentSpeed var contactTangentImpulse = contact.tangentImpulse; contact.tangentImpulse = Common.clamp(contact.tangentImpulse + tangentImpulse, -maxFriction, maxFriction); tangentImpulse = contact.tangentImpulse - contactTangentImpulse; } // total impulse from contact impulse.x = (normal.x * normalImpulse) + (tangent.x * tangentImpulse); impulse.y = (normal.y * normalImpulse) + (tangent.y * tangentImpulse); // apply impulse from contact if (!(bodyA.isStatic || bodyA.isSleeping)) { bodyA.positionPrev.x += impulse.x * bodyA.inverseMass; bodyA.positionPrev.y += impulse.y * bodyA.inverseMass; bodyA.anglePrev += Vector.cross(offsetA, impulse) * bodyA.inverseInertia; } if (!(bodyB.isStatic || bodyB.isSleeping)) { bodyB.positionPrev.x -= impulse.x * bodyB.inverseMass; bodyB.positionPrev.y -= impulse.y * bodyB.inverseMass; bodyB.anglePrev -= Vector.cross(offsetB, impulse) * bodyB.inverseInertia; } } } }; })(); },{"../core/Common":14,"../geometry/Bounds":24,"../geometry/Vector":26,"../geometry/Vertices":27}],11:[function(require,module,exports){ /** * The `Matter.SAT` module contains methods for detecting collisions using the Separating Axis Theorem. * * @class SAT */ // TODO: true circles and curves var SAT = {}; module.exports = SAT; var Vertices = require('../geometry/Vertices'); var Vector = require('../geometry/Vector'); (function() { /** * Detect collision between two bodies using the Separating Axis Theorem. * @method collides * @param {body} bodyA * @param {body} bodyB * @param {collision} previousCollision * @return {collision} collision */ SAT.collides = function(bodyA, bodyB, previousCollision) { var overlapAB, overlapBA, minOverlap, collision, prevCol = previousCollision, canReusePrevCol = false; if (prevCol) { // estimate total motion var parentA = bodyA.parent, parentB = bodyB.parent, motion = parentA.speed * parentA.speed + parentA.angularSpeed * parentA.angularSpeed + parentB.speed * parentB.speed + parentB.angularSpeed * parentB.angularSpeed; // we may be able to (partially) reuse collision result // but only safe if collision was resting canReusePrevCol = prevCol && prevCol.collided && motion < 0.2; // reuse collision object collision = prevCol; } else { collision = { collided: false, bodyA: bodyA, bodyB: bodyB }; } if (prevCol && canReusePrevCol) { // if we can reuse the collision result // we only need to test the previously found axis var axisBodyA = collision.axisBody, axisBodyB = axisBodyA === bodyA ? bodyB : bodyA, axes = [axisBodyA.axes[prevCol.axisNumber]]; minOverlap = _overlapAxes(axisBodyA.vertices, axisBodyB.vertices, axes); collision.reused = true; if (minOverlap.overlap <= 0) { collision.collided = false; return collision; } } else { // if we can't reuse a result, perform a full SAT test overlapAB = _overlapAxes(bodyA.vertices, bodyB.vertices, bodyA.axes); if (overlapAB.overlap <= 0) { collision.collided = false; return collision; } overlapBA = _overlapAxes(bodyB.vertices, bodyA.vertices, bodyB.axes); if (overlapBA.overlap <= 0) { collision.collided = false; return collision; } if (overlapAB.overlap < overlapBA.overlap) { minOverlap = overlapAB; collision.axisBody = bodyA; } else { minOverlap = overlapBA; collision.axisBody = bodyB; } // important for reuse later collision.axisNumber = minOverlap.axisNumber; } collision.bodyA = bodyA.id < bodyB.id ? bodyA : bodyB; collision.bodyB = bodyA.id < bodyB.id ? bodyB : bodyA; collision.collided = true; collision.normal = minOverlap.axis; collision.depth = minOverlap.overlap; collision.parentA = collision.bodyA.parent; collision.parentB = collision.bodyB.parent; bodyA = collision.bodyA; bodyB = collision.bodyB; // ensure normal is facing away from bodyA if (Vector.dot(collision.normal, Vector.sub(bodyB.position, bodyA.position)) > 0) collision.normal = Vector.neg(collision.normal); collision.tangent = Vector.perp(collision.normal); collision.penetration = { x: collision.normal.x * collision.depth, y: collision.normal.y * collision.depth }; // find support points, there is always either exactly one or two var verticesB = _findSupports(bodyA, bodyB, collision.normal), supports = collision.supports || []; supports.length = 0; // find the supports from bodyB that are inside bodyA if (Vertices.contains(bodyA.vertices, verticesB[0])) supports.push(verticesB[0]); if (Vertices.contains(bodyA.vertices, verticesB[1])) supports.push(verticesB[1]); // find the supports from bodyA that are inside bodyB if (supports.length < 2) { var verticesA = _findSupports(bodyB, bodyA, Vector.neg(collision.normal)); if (Vertices.contains(bodyB.vertices, verticesA[0])) supports.push(verticesA[0]); if (supports.length < 2 && Vertices.contains(bodyB.vertices, verticesA[1])) supports.push(verticesA[1]); } // account for the edge case of overlapping but no vertex containment if (supports.length < 1) supports = [verticesB[0]]; collision.supports = supports; return collision; }; /** * Find the overlap between two sets of vertices. * @method _overlapAxes * @private * @param {} verticesA * @param {} verticesB * @param {} axes * @return result */ var _overlapAxes = function(verticesA, verticesB, axes) { var projectionA = Vector._temp[0], projectionB = Vector._temp[1], result = { overlap: Number.MAX_VALUE }, overlap, axis; for (var i = 0; i < axes.length; i++) { axis = axes[i]; _projectToAxis(projectionA, verticesA, axis); _projectToAxis(projectionB, verticesB, axis); overlap = Math.min(projectionA.max - projectionB.min, projectionB.max - projectionA.min); if (overlap <= 0) { result.overlap = overlap; return result; } if (overlap < result.overlap) { result.overlap = overlap; result.axis = axis; result.axisNumber = i; } } return result; }; /** * Projects vertices on an axis and returns an interval. * @method _projectToAxis * @private * @param {} projection * @param {} vertices * @param {} axis */ var _projectToAxis = function(projection, vertices, axis) { var min = Vector.dot(vertices[0], axis), max = min; for (var i = 1; i < vertices.length; i += 1) { var dot = Vector.dot(vertices[i], axis); if (dot > max) { max = dot; } else if (dot < min) { min = dot; } } projection.min = min; projection.max = max; }; /** * Finds supporting vertices given two bodies along a given direction using hill-climbing. * @method _findSupports * @private * @param {} bodyA * @param {} bodyB * @param {} normal * @return [vector] */ var _findSupports = function(bodyA, bodyB, normal) { var nearestDistance = Number.MAX_VALUE, vertexToBody = Vector._temp[0], vertices = bodyB.vertices, bodyAPosition = bodyA.position, distance, vertex, vertexA, vertexB; // find closest vertex on bodyB for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { nearestDistance = distance; vertexA = vertex; } } // find next closest vertex using the two connected to it var prevIndex = vertexA.index - 1 >= 0 ? vertexA.index - 1 : vertices.length - 1; vertex = vertices[prevIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; nearestDistance = -Vector.dot(normal, vertexToBody); vertexB = vertex; var nextIndex = (vertexA.index + 1) % vertices.length; vertex = vertices[nextIndex]; vertexToBody.x = vertex.x - bodyAPosition.x; vertexToBody.y = vertex.y - bodyAPosition.y; distance = -Vector.dot(normal, vertexToBody); if (distance < nearestDistance) { vertexB = vertex; } return [vertexA, vertexB]; }; })(); },{"../geometry/Vector":26,"../geometry/Vertices":27}],12:[function(require,module,exports){ /** * The `Matter.Constraint` module contains methods for creating and manipulating constraints. * Constraints are used for specifying that a fixed distance must be maintained between two bodies (or a body and a fixed world-space position). * The stiffness of constraints can be modified to create springs or elastic. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Constraint */ // TODO: fix instability issues with torque // TODO: linked constraints // TODO: breakable constraints // TODO: collision constraints // TODO: allow constrained bodies to sleep // TODO: handle 0 length constraints properly // TODO: impulse caching and warming var Constraint = {}; module.exports = Constraint; var Vertices = require('../geometry/Vertices'); var Vector = require('../geometry/Vector'); var Sleeping = require('../core/Sleeping'); var Bounds = require('../geometry/Bounds'); var Axes = require('../geometry/Axes'); var Common = require('../core/Common'); (function() { var _minLength = 0.000001, _minDifference = 0.001; /** * Creates a new constraint. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properties section below for detailed information on what you can pass via the `options` object. * @method create * @param {} options * @return {constraint} constraint */ Constraint.create = function(options) { var constraint = options; // if bodies defined but no points, use body centre if (constraint.bodyA && !constraint.pointA) constraint.pointA = { x: 0, y: 0 }; if (constraint.bodyB && !constraint.pointB) constraint.pointB = { x: 0, y: 0 }; // calculate static length using initial world space points var initialPointA = constraint.bodyA ? Vector.add(constraint.bodyA.position, constraint.pointA) : constraint.pointA, initialPointB = constraint.bodyB ? Vector.add(constraint.bodyB.position, constraint.pointB) : constraint.pointB, length = Vector.magnitude(Vector.sub(initialPointA, initialPointB)); constraint.length = constraint.length || length || _minLength; // render var render = { visible: true, lineWidth: 2, strokeStyle: '#666' }; constraint.render = Common.extend(render, constraint.render); // option defaults constraint.id = constraint.id || Common.nextId(); constraint.label = constraint.label || 'Constraint'; constraint.type = 'constraint'; constraint.stiffness = constraint.stiffness || 1; constraint.angularStiffness = constraint.angularStiffness || 0; constraint.angleA = constraint.bodyA ? constraint.bodyA.angle : constraint.angleA; constraint.angleB = constraint.bodyB ? constraint.bodyB.angle : constraint.angleB; return constraint; }; /** * Solves all constraints in a list of collisions. * @private * @method solveAll * @param {constraint[]} constraints * @param {number} timeScale */ Constraint.solveAll = function(constraints, timeScale) { for (var i = 0; i < constraints.length; i++) { Constraint.solve(constraints[i], timeScale); } }; /** * Solves a distance constraint with Gauss-Siedel method. * @private * @method solve * @param {constraint} constraint * @param {number} timeScale */ Constraint.solve = function(constraint, timeScale) { var bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB; // update reference angle if (bodyA && !bodyA.isStatic) { constraint.pointA = Vector.rotate(pointA, bodyA.angle - constraint.angleA); constraint.angleA = bodyA.angle; } // update reference angle if (bodyB && !bodyB.isStatic) { constraint.pointB = Vector.rotate(pointB, bodyB.angle - constraint.angleB); constraint.angleB = bodyB.angle; } var pointAWorld = pointA, pointBWorld = pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, pointB); if (!pointAWorld || !pointBWorld) return; var delta = Vector.sub(pointAWorld, pointBWorld), currentLength = Vector.magnitude(delta); // prevent singularity if (currentLength === 0) currentLength = _minLength; // solve distance constraint with Gauss-Siedel method var difference = (currentLength - constraint.length) / currentLength, normal = Vector.div(delta, currentLength), force = Vector.mult(delta, difference * 0.5 * constraint.stiffness * timeScale * timeScale); // if difference is very small, we can skip if (Math.abs(1 - (currentLength / constraint.length)) < _minDifference * timeScale) return; var velocityPointA, velocityPointB, offsetA, offsetB, oAn, oBn, bodyADenom, bodyBDenom; if (bodyA && !bodyA.isStatic) { // point body offset offsetA = { x: pointAWorld.x - bodyA.position.x + force.x, y: pointAWorld.y - bodyA.position.y + force.y }; // update velocity bodyA.velocity.x = bodyA.position.x - bodyA.positionPrev.x; bodyA.velocity.y = bodyA.position.y - bodyA.positionPrev.y; bodyA.angularVelocity = bodyA.angle - bodyA.anglePrev; // find point velocity and body mass velocityPointA = Vector.add(bodyA.velocity, Vector.mult(Vector.perp(offsetA), bodyA.angularVelocity)); oAn = Vector.dot(offsetA, normal); bodyADenom = bodyA.inverseMass + bodyA.inverseInertia * oAn * oAn; } else { velocityPointA = { x: 0, y: 0 }; bodyADenom = bodyA ? bodyA.inverseMass : 0; } if (bodyB && !bodyB.isStatic) { // point body offset offsetB = { x: pointBWorld.x - bodyB.position.x - force.x, y: pointBWorld.y - bodyB.position.y - force.y }; // update velocity bodyB.velocity.x = bodyB.position.x - bodyB.positionPrev.x; bodyB.velocity.y = bodyB.position.y - bodyB.positionPrev.y; bodyB.angularVelocity = bodyB.angle - bodyB.anglePrev; // find point velocity and body mass velocityPointB = Vector.add(bodyB.velocity, Vector.mult(Vector.perp(offsetB), bodyB.angularVelocity)); oBn = Vector.dot(offsetB, normal); bodyBDenom = bodyB.inverseMass + bodyB.inverseInertia * oBn * oBn; } else { velocityPointB = { x: 0, y: 0 }; bodyBDenom = bodyB ? bodyB.inverseMass : 0; } var relativeVelocity = Vector.sub(velocityPointB, velocityPointA), normalImpulse = Vector.dot(normal, relativeVelocity) / (bodyADenom + bodyBDenom); if (normalImpulse > 0) normalImpulse = 0; var normalVelocity = { x: normal.x * normalImpulse, y: normal.y * normalImpulse }; var torque; if (bodyA && !bodyA.isStatic) { torque = Vector.cross(offsetA, normalVelocity) * bodyA.inverseInertia * (1 - constraint.angularStiffness); // keep track of applied impulses for post solving bodyA.constraintImpulse.x -= force.x; bodyA.constraintImpulse.y -= force.y; bodyA.constraintImpulse.angle += torque; // apply forces bodyA.position.x -= force.x; bodyA.position.y -= force.y; bodyA.angle += torque; } if (bodyB && !bodyB.isStatic) { torque = Vector.cross(offsetB, normalVelocity) * bodyB.inverseInertia * (1 - constraint.angularStiffness); // keep track of applied impulses for post solving bodyB.constraintImpulse.x += force.x; bodyB.constraintImpulse.y += force.y; bodyB.constraintImpulse.angle -= torque; // apply forces bodyB.position.x += force.x; bodyB.position.y += force.y; bodyB.angle -= torque; } }; /** * Performs body updates required after solving constraints. * @private * @method postSolveAll * @param {body[]} bodies */ Constraint.postSolveAll = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i], impulse = body.constraintImpulse; if (impulse.x === 0 && impulse.y === 0 && impulse.angle === 0) { continue; } Sleeping.set(body, false); // update geometry and reset for (var j = 0; j < body.parts.length; j++) { var part = body.parts[j]; Vertices.translate(part.vertices, impulse); if (j > 0) { part.position.x += impulse.x; part.position.y += impulse.y; } if (impulse.angle !== 0) { Vertices.rotate(part.vertices, impulse.angle, body.position); Axes.rotate(part.axes, impulse.angle); if (j > 0) { Vector.rotateAbout(part.position, impulse.angle, body.position, part.position); } } Bounds.update(part.bounds, part.vertices, body.velocity); } impulse.angle = 0; impulse.x = 0; impulse.y = 0; } }; /* * * Properties Documentation * */ /** * An integer `Number` uniquely identifying number generated in `Composite.create` by `Common.nextId`. * * @property id * @type number */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "constraint" * @readOnly */ /** * An arbitrary `String` name to help the user identify and manage bodies. * * @property label * @type string * @default "Constraint" */ /** * An `Object` that defines the rendering properties to be consumed by the module `Matter.Render`. * * @property render * @type object */ /** * A flag that indicates if the constraint should be rendered. * * @property render.visible * @type boolean * @default true */ /** * A `Number` that defines the line width to use when rendering the constraint outline. * A value of `0` means no outline will be rendered. * * @property render.lineWidth * @type number * @default 2 */ /** * A `String` that defines the stroke style to use when rendering the constraint outline. * It is the same as when using a canvas, so it accepts CSS style property values. * * @property render.strokeStyle * @type string * @default a random colour */ /** * The first possible `Body` that this constraint is attached to. * * @property bodyA * @type body * @default null */ /** * The second possible `Body` that this constraint is attached to. * * @property bodyB * @type body * @default null */ /** * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyA` if defined, otherwise a world-space position. * * @property pointA * @type vector * @default { x: 0, y: 0 } */ /** * A `Vector` that specifies the offset of the constraint from center of the `constraint.bodyA` if defined, otherwise a world-space position. * * @property pointB * @type vector * @default { x: 0, y: 0 } */ /** * A `Number` that specifies the stiffness of the constraint, i.e. the rate at which it returns to its resting `constraint.length`. * A value of `1` means the constraint should be very stiff. * A value of `0.2` means the constraint acts like a soft spring. * * @property stiffness * @type number * @default 1 */ /** * A `Number` that specifies the target resting length of the constraint. * It is calculated automatically in `Constraint.create` from initial positions of the `constraint.bodyA` and `constraint.bodyB`. * * @property length * @type number */ })(); },{"../core/Common":14,"../core/Sleeping":20,"../geometry/Axes":23,"../geometry/Bounds":24,"../geometry/Vector":26,"../geometry/Vertices":27}],13:[function(require,module,exports){ /** * The `Matter.MouseConstraint` module contains methods for creating mouse constraints. * Mouse constraints are used for allowing user interaction, providing the ability to move bodies via the mouse or touch. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class MouseConstraint */ var MouseConstraint = {}; module.exports = MouseConstraint; var Vertices = require('../geometry/Vertices'); var Sleeping = require('../core/Sleeping'); var Mouse = require('../core/Mouse'); var Events = require('../core/Events'); var Detector = require('../collision/Detector'); var Constraint = require('./Constraint'); var Composite = require('../body/Composite'); var Common = require('../core/Common'); var Bounds = require('../geometry/Bounds'); (function() { /** * Creates a new mouse constraint. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properties section below for detailed information on what you can pass via the `options` object. * @method create * @param {engine} engine * @param {} options * @return {MouseConstraint} A new MouseConstraint */ MouseConstraint.create = function(engine, options) { var mouse = (engine ? engine.mouse : null) || (options ? options.mouse : null); if (!mouse) { if (engine && engine.render && engine.render.canvas) { mouse = Mouse.create(engine.render.canvas); } else if (options && options.element) { mouse = Mouse.create(options.element); } else { mouse = Mouse.create(); Common.log('MouseConstraint.create: options.mouse was undefined, options.element was undefined, may not function as expected', 'warn'); } } var constraint = Constraint.create({ label: 'Mouse Constraint', pointA: mouse.position, pointB: { x: 0, y: 0 }, length: 0.01, stiffness: 0.1, angularStiffness: 1, render: { strokeStyle: '#90EE90', lineWidth: 3 } }); var defaults = { type: 'mouseConstraint', mouse: mouse, element: null, body: null, constraint: constraint, collisionFilter: { category: 0x0001, mask: 0xFFFFFFFF, group: 0 } }; var mouseConstraint = Common.extend(defaults, options); Events.on(engine, 'tick', function() { var allBodies = Composite.allBodies(engine.world); MouseConstraint.update(mouseConstraint, allBodies); _triggerEvents(mouseConstraint); }); return mouseConstraint; }; /** * Updates the given mouse constraint. * @private * @method update * @param {MouseConstraint} mouseConstraint * @param {body[]} bodies */ MouseConstraint.update = function(mouseConstraint, bodies) { var mouse = mouseConstraint.mouse, constraint = mouseConstraint.constraint, body = mouseConstraint.body; if (mouse.button === 0) { if (!constraint.bodyB) { for (var i = 0; i < bodies.length; i++) { body = bodies[i]; if (Bounds.contains(body.bounds, mouse.position) && Detector.canCollide(body.collisionFilter, mouseConstraint.collisionFilter)) { for (var j = body.parts.length > 1 ? 1 : 0; j < body.parts.length; j++) { var part = body.parts[j]; if (Vertices.contains(part.vertices, mouse.position)) { constraint.pointA = mouse.position; constraint.bodyB = mouseConstraint.body = body; constraint.pointB = { x: mouse.position.x - body.position.x, y: mouse.position.y - body.position.y }; constraint.angleB = body.angle; Sleeping.set(body, false); Events.trigger(mouseConstraint, 'startdrag', { mouse: mouse, body: body }); break; } } } } } else { Sleeping.set(constraint.bodyB, false); constraint.pointA = mouse.position; } } else { constraint.bodyB = mouseConstraint.body = null; constraint.pointB = null; if (body) Events.trigger(mouseConstraint, 'enddrag', { mouse: mouse, body: body }); } }; /** * Triggers mouse constraint events. * @method _triggerEvents * @private * @param {mouse} mouseConstraint */ var _triggerEvents = function(mouseConstraint) { var mouse = mouseConstraint.mouse, mouseEvents = mouse.sourceEvents; if (mouseEvents.mousemove) Events.trigger(mouseConstraint, 'mousemove', { mouse: mouse }); if (mouseEvents.mousedown) Events.trigger(mouseConstraint, 'mousedown', { mouse: mouse }); if (mouseEvents.mouseup) Events.trigger(mouseConstraint, 'mouseup', { mouse: mouse }); // reset the mouse state ready for the next step Mouse.clearSourceEvents(mouse); }; /* * * Events Documentation * */ /** * Fired when the mouse has moved (or a touch moves) during the last step * * @event mousemove * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is down (or a touch has started) during the last step * * @event mousedown * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the mouse is up (or a touch has ended) during the last step * * @event mouseup * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the user starts dragging a body * * @event startdrag * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {body} event.body The body being dragged * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired when the user ends dragging a body * * @event enddrag * @param {} event An event object * @param {mouse} event.mouse The engine's mouse instance * @param {body} event.body The body that has stopped being dragged * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * A `String` denoting the type of object. * * @property type * @type string * @default "constraint" * @readOnly */ /** * The `Mouse` instance in use. If not supplied in `MouseConstraint.create`, one will be created. * * @property mouse * @type mouse * @default mouse */ /** * The `Body` that is currently being moved by the user, or `null` if no body. * * @property body * @type body * @default null */ /** * The `Constraint` object that is used to move the body during interaction. * * @property constraint * @type constraint */ /** * An `Object` that specifies the collision filter properties. * The collision filter allows the user to define which types of body this mouse constraint can interact with. * See `body.collisionFilter` for more information. * * @property collisionFilter * @type object */ })(); },{"../body/Composite":2,"../collision/Detector":5,"../core/Common":14,"../core/Events":16,"../core/Mouse":18,"../core/Sleeping":20,"../geometry/Bounds":24,"../geometry/Vertices":27,"./Constraint":12}],14:[function(require,module,exports){ /** * The `Matter.Common` module contains utility functions that are common to all modules. * * @class Common */ var Common = {}; module.exports = Common; (function() { Common._nextId = 0; Common._seed = 0; /** * Extends the object in the first argument using the object in the second argument. * @method extend * @param {} obj * @param {boolean} deep * @return {} obj extended */ Common.extend = function(obj, deep) { var argsStart, args, deepClone; if (typeof deep === 'boolean') { argsStart = 2; deepClone = deep; } else { argsStart = 1; deepClone = true; } args = Array.prototype.slice.call(arguments, argsStart); for (var i = 0; i < args.length; i++) { var source = args[i]; if (source) { for (var prop in source) { if (deepClone && source[prop] && source[prop].constructor === Object) { if (!obj[prop] || obj[prop].constructor === Object) { obj[prop] = obj[prop] || {}; Common.extend(obj[prop], deepClone, source[prop]); } else { obj[prop] = source[prop]; } } else { obj[prop] = source[prop]; } } } } return obj; }; /** * Creates a new clone of the object, if deep is true references will also be cloned. * @method clone * @param {} obj * @param {bool} deep * @return {} obj cloned */ Common.clone = function(obj, deep) { return Common.extend({}, deep, obj); }; /** * Returns the list of keys for the given object. * @method keys * @param {} obj * @return {string[]} keys */ Common.keys = function(obj) { if (Object.keys) return Object.keys(obj); // avoid hasOwnProperty for performance var keys = []; for (var key in obj) keys.push(key); return keys; }; /** * Returns the list of values for the given object. * @method values * @param {} obj * @return {array} Array of the objects property values */ Common.values = function(obj) { var values = []; if (Object.keys) { var keys = Object.keys(obj); for (var i = 0; i < keys.length; i++) { values.push(obj[keys[i]]); } return values; } // avoid hasOwnProperty for performance for (var key in obj) values.push(obj[key]); return values; }; /** * Returns a hex colour string made by lightening or darkening color by percent. * @method shadeColor * @param {string} color * @param {number} percent * @return {string} A hex colour */ Common.shadeColor = function(color, percent) { // http://stackoverflow.com/questions/5560248/programmatically-lighten-or-darken-a-hex-color var colorInteger = parseInt(color.slice(1),16), amount = Math.round(2.55 * percent), R = (colorInteger >> 16) + amount, B = (colorInteger >> 8 & 0x00FF) + amount, G = (colorInteger & 0x0000FF) + amount; return "#" + (0x1000000 + (R < 255 ? R < 1 ? 0 : R :255) * 0x10000 + (B < 255 ? B < 1 ? 0 : B : 255) * 0x100 + (G < 255 ? G < 1 ? 0 : G : 255)).toString(16).slice(1); }; /** * Shuffles the given array in-place. * The function uses a seeded random generator. * @method shuffle * @param {array} array * @return {array} array shuffled randomly */ Common.shuffle = function(array) { for (var i = array.length - 1; i > 0; i--) { var j = Math.floor(Common.random() * (i + 1)); var temp = array[i]; array[i] = array[j]; array[j] = temp; } return array; }; /** * Randomly chooses a value from a list with equal probability. * The function uses a seeded random generator. * @method choose * @param {array} choices * @return {object} A random choice object from the array */ Common.choose = function(choices) { return choices[Math.floor(Common.random() * choices.length)]; }; /** * Returns true if the object is a HTMLElement, otherwise false. * @method isElement * @param {object} obj * @return {boolean} True if the object is a HTMLElement, otherwise false */ Common.isElement = function(obj) { // http://stackoverflow.com/questions/384286/javascript-isdom-how-do-you-check-if-a-javascript-object-is-a-dom-object try { return obj instanceof HTMLElement; } catch(e){ return (typeof obj==="object") && (obj.nodeType===1) && (typeof obj.style === "object") && (typeof obj.ownerDocument ==="object"); } }; /** * Returns true if the object is an array. * @method isArray * @param {object} obj * @return {boolean} True if the object is an array, otherwise false */ Common.isArray = function(obj) { return Object.prototype.toString.call(obj) === '[object Array]'; }; /** * Returns the given value clamped between a minimum and maximum value. * @method clamp * @param {number} value * @param {number} min * @param {number} max * @return {number} The value clamped between min and max inclusive */ Common.clamp = function(value, min, max) { if (value < min) return min; if (value > max) return max; return value; }; /** * Returns the sign of the given value. * @method sign * @param {number} value * @return {number} -1 if negative, +1 if 0 or positive */ Common.sign = function(value) { return value < 0 ? -1 : 1; }; /** * Returns the current timestamp (high-res if available). * @method now * @return {number} the current timestamp (high-res if available) */ Common.now = function() { // http://stackoverflow.com/questions/221294/how-do-you-get-a-timestamp-in-javascript // https://gist.github.com/davidwaterston/2982531 var performance = window.performance || {}; performance.now = (function() { return performance.now || performance.webkitNow || performance.msNow || performance.oNow || performance.mozNow || function() { return +(new Date()); }; })(); return performance.now(); }; /** * Returns a random value between a minimum and a maximum value inclusive. * The function uses a seeded random generator. * @method random * @param {number} min * @param {number} max * @return {number} A random number between min and max inclusive */ Common.random = function(min, max) { min = (typeof min !== "undefined") ? min : 0; max = (typeof max !== "undefined") ? max : 1; return min + _seededRandom() * (max - min); }; /** * Converts a CSS hex colour string into an integer. * @method colorToNumber * @param {string} colorString * @return {number} An integer representing the CSS hex string */ Common.colorToNumber = function(colorString) { colorString = colorString.replace('#',''); if (colorString.length == 3) { colorString = colorString.charAt(0) + colorString.charAt(0) + colorString.charAt(1) + colorString.charAt(1) + colorString.charAt(2) + colorString.charAt(2); } return parseInt(colorString, 16); }; /** * A wrapper for console.log, for providing errors and warnings. * @method log * @param {string} message * @param {string} type */ Common.log = function(message, type) { if (!console || !console.log || !console.warn) return; switch (type) { case 'warn': console.warn('Matter.js:', message); break; case 'error': console.log('Matter.js:', message); break; } }; /** * Returns the next unique sequential ID. * @method nextId * @return {Number} Unique sequential ID */ Common.nextId = function() { return Common._nextId++; }; /** * A cross browser compatible indexOf implementation. * @method indexOf * @param {array} haystack * @param {object} needle */ Common.indexOf = function(haystack, needle) { if (haystack.indexOf) return haystack.indexOf(needle); for (var i = 0; i < haystack.length; i++) { if (haystack[i] === needle) return i; } return -1; }; var _seededRandom = function() { // https://gist.github.com/ngryman/3830489 Common._seed = (Common._seed * 9301 + 49297) % 233280; return Common._seed / 233280; }; })(); },{}],15:[function(require,module,exports){ /** * The `Matter.Engine` module contains methods for creating and manipulating engines. * An engine is a controller that manages updating the simulation of the world. * See `Matter.Runner` for an optional game loop utility. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Engine */ var Engine = {}; module.exports = Engine; var World = require('../body/World'); var Sleeping = require('./Sleeping'); var Resolver = require('../collision/Resolver'); var Render = require('../render/Render'); var Pairs = require('../collision/Pairs'); var Metrics = require('./Metrics'); var Grid = require('../collision/Grid'); var Events = require('./Events'); var Composite = require('../body/Composite'); var Constraint = require('../constraint/Constraint'); var Common = require('./Common'); var Body = require('../body/Body'); (function() { /** * Creates a new engine. The options parameter is an object that specifies any properties you wish to override the defaults. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properties section below for detailed information on what you can pass via the `options` object. * @method create * @param {object} [options] * @return {engine} engine */ Engine.create = function(element, options) { // options may be passed as the first (and only) argument options = Common.isElement(element) ? options : element; element = Common.isElement(element) ? element : null; options = options || {}; if (element || options.render) { Common.log('Engine.create: engine.render is deprecated (see docs)', 'warn'); } var defaults = { positionIterations: 6, velocityIterations: 4, constraintIterations: 2, enableSleeping: false, events: [], timing: { timestamp: 0, timeScale: 1 }, broadphase: { controller: Grid } }; var engine = Common.extend(defaults, options); // @deprecated if (element || engine.render) { var renderDefaults = { element: element, controller: Render }; engine.render = Common.extend(renderDefaults, engine.render); } // @deprecated if (engine.render && engine.render.controller) { engine.render = engine.render.controller.create(engine.render); } // @deprecated if (engine.render) { engine.render.engine = engine; } engine.world = options.world || World.create(engine.world); engine.pairs = Pairs.create(); engine.broadphase = engine.broadphase.controller.create(engine.broadphase); engine.metrics = engine.metrics || { extended: false }; return engine; }; /** * Moves the simulation forward in time by `delta` ms. * The `correction` argument is an optional `Number` that specifies the time correction factor to apply to the update. * This can help improve the accuracy of the simulation in cases where `delta` is changing between updates. * The value of `correction` is defined as `delta / lastDelta`, i.e. the percentage change of `delta` over the last step. * Therefore the value is always `1` (no correction) when `delta` constant (or when no correction is desired, which is the default). * See the paper on Time Corrected Verlet for more information. * * Triggers `beforeUpdate` and `afterUpdate` events. * Triggers `collisionStart`, `collisionActive` and `collisionEnd` events. * @method update * @param {engine} engine * @param {number} [delta=16.666] * @param {number} [correction=1] */ Engine.update = function(engine, delta, correction) { delta = delta || 1000 / 60; correction = correction || 1; var world = engine.world, timing = engine.timing, broadphase = engine.broadphase, broadphasePairs = [], i; // increment timestamp timing.timestamp += delta * timing.timeScale; // create an event object var event = { timestamp: timing.timestamp }; Events.trigger(engine, 'beforeUpdate', event); // get lists of all bodies and constraints, no matter what composites they are in var allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world); // if sleeping enabled, call the sleeping controller if (engine.enableSleeping) Sleeping.update(allBodies, timing.timeScale); // applies gravity to all bodies _bodiesApplyGravity(allBodies, world.gravity); // update all body position and rotation by integration _bodiesUpdate(allBodies, delta, timing.timeScale, correction, world.bounds); // update all constraints for (i = 0; i < engine.constraintIterations; i++) { Constraint.solveAll(allConstraints, timing.timeScale); } Constraint.postSolveAll(allBodies); // broadphase pass: find potential collision pairs if (broadphase.controller) { // if world is dirty, we must flush the whole grid if (world.isModified) broadphase.controller.clear(broadphase); // update the grid buckets based on current bodies broadphase.controller.update(broadphase, allBodies, engine, world.isModified); broadphasePairs = broadphase.pairsList; } else { // if no broadphase set, we just pass all bodies broadphasePairs = allBodies; } // clear all composite modified flags if (world.isModified) { Composite.setModified(world, false, false, true); } // narrowphase pass: find actual collisions, then create or update collision pairs var collisions = broadphase.detector(broadphasePairs, engine); // update collision pairs var pairs = engine.pairs, timestamp = timing.timestamp; Pairs.update(pairs, collisions, timestamp); Pairs.removeOld(pairs, timestamp); // wake up bodies involved in collisions if (engine.enableSleeping) Sleeping.afterCollisions(pairs.list, timing.timeScale); // trigger collision events if (pairs.collisionStart.length > 0) Events.trigger(engine, 'collisionStart', { pairs: pairs.collisionStart }); // iteratively resolve position between collisions Resolver.preSolvePosition(pairs.list); for (i = 0; i < engine.positionIterations; i++) { Resolver.solvePosition(pairs.list, timing.timeScale); } Resolver.postSolvePosition(allBodies); // iteratively resolve velocity between collisions Resolver.preSolveVelocity(pairs.list); for (i = 0; i < engine.velocityIterations; i++) { Resolver.solveVelocity(pairs.list, timing.timeScale); } // trigger collision events if (pairs.collisionActive.length > 0) Events.trigger(engine, 'collisionActive', { pairs: pairs.collisionActive }); if (pairs.collisionEnd.length > 0) Events.trigger(engine, 'collisionEnd', { pairs: pairs.collisionEnd }); // clear force buffers _bodiesClearForces(allBodies); Events.trigger(engine, 'afterUpdate', event); return engine; }; /** * Merges two engines by keeping the configuration of `engineA` but replacing the world with the one from `engineB`. * @method merge * @param {engine} engineA * @param {engine} engineB */ Engine.merge = function(engineA, engineB) { Common.extend(engineA, engineB); if (engineB.world) { engineA.world = engineB.world; Engine.clear(engineA); var bodies = Composite.allBodies(engineA.world); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; Sleeping.set(body, false); body.id = Common.nextId(); } } }; /** * Clears the engine including the world, pairs and broadphase. * @method clear * @param {engine} engine */ Engine.clear = function(engine) { var world = engine.world; Pairs.clear(engine.pairs); var broadphase = engine.broadphase; if (broadphase.controller) { var bodies = Composite.allBodies(world); broadphase.controller.clear(broadphase); broadphase.controller.update(broadphase, bodies, engine, true); } }; /** * Zeroes the `body.force` and `body.torque` force buffers. * @method bodiesClearForces * @private * @param {body[]} bodies */ var _bodiesClearForces = function(bodies) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; // reset force buffers body.force.x = 0; body.force.y = 0; body.torque = 0; } }; /** * Applys a mass dependant force to all given bodies. * @method bodiesApplyGravity * @private * @param {body[]} bodies * @param {vector} gravity */ var _bodiesApplyGravity = function(bodies, gravity) { var gravityScale = typeof gravity.scale !== 'undefined' ? gravity.scale : 0.001; if ((gravity.x === 0 && gravity.y === 0) || gravityScale === 0) { return; } for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; // apply gravity body.force.y += body.mass * gravity.y * gravityScale; body.force.x += body.mass * gravity.x * gravityScale; } }; /** * Applys `Body.update` to all given `bodies`. * @method updateAll * @private * @param {body[]} bodies * @param {number} deltaTime * The amount of time elapsed between updates * @param {number} timeScale * @param {number} correction * The Verlet correction factor (deltaTime / lastDeltaTime) * @param {bounds} worldBounds */ var _bodiesUpdate = function(bodies, deltaTime, timeScale, correction, worldBounds) { for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.isStatic || body.isSleeping) continue; Body.update(body, deltaTime, timeScale, correction); } }; /** * An alias for `Runner.run`, see `Matter.Runner` for more information. * @method run * @param {engine} engine */ /** * Fired just before an update * * @event beforeUpdate * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update and all collision events * * @event afterUpdate * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have started to collide in the current tick (if any) * * @event collisionStart * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that are colliding in the current tick (if any) * * @event collisionActive * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine update, provides a list of all pairs that have ended collision in the current tick (if any) * * @event collisionEnd * @param {} event An event object * @param {} event.pairs List of affected pairs * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * An integer `Number` that specifies the number of position iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * * @property positionIterations * @type number * @default 6 */ /** * An integer `Number` that specifies the number of velocity iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * * @property velocityIterations * @type number * @default 4 */ /** * An integer `Number` that specifies the number of constraint iterations to perform each update. * The higher the value, the higher quality the simulation will be at the expense of performance. * The default value of `2` is usually very adequate. * * @property constraintIterations * @type number * @default 2 */ /** * A flag that specifies whether the engine should allow sleeping via the `Matter.Sleeping` module. * Sleeping can improve stability and performance, but often at the expense of accuracy. * * @property enableSleeping * @type boolean * @default false */ /** * An `Object` containing properties regarding the timing systems of the engine. * * @property timing * @type object */ /** * A `Number` that specifies the global scaling factor of time for all bodies. * A value of `0` freezes the simulation. * A value of `0.1` gives a slow-motion effect. * A value of `1.2` gives a speed-up effect. * * @property timing.timeScale * @type number * @default 1 */ /** * A `Number` that specifies the current simulation-time in milliseconds starting from `0`. * It is incremented on every `Engine.update` by the given `delta` argument. * * @property timing.timestamp * @type number * @default 0 */ /** * An instance of a `Render` controller. The default value is a `Matter.Render` instance created by `Engine.create`. * One may also develop a custom renderer module based on `Matter.Render` and pass an instance of it to `Engine.create` via `options.render`. * * A minimal custom renderer object must define at least three functions: `create`, `clear` and `world` (see `Matter.Render`). * It is also possible to instead pass the _module_ reference via `options.render.controller` and `Engine.create` will instantiate one for you. * * @property render * @type render * @deprecated see Demo.js for an example of creating a renderer * @default a Matter.Render instance */ /** * An instance of a broadphase controller. The default value is a `Matter.Grid` instance created by `Engine.create`. * * @property broadphase * @type grid * @default a Matter.Grid instance */ /** * A `World` composite object that will contain all simulated bodies and constraints. * * @property world * @type world * @default a Matter.World instance */ })(); },{"../body/Body":1,"../body/Composite":2,"../body/World":3,"../collision/Grid":6,"../collision/Pairs":8,"../collision/Resolver":10,"../constraint/Constraint":12,"../render/Render":29,"./Common":14,"./Events":16,"./Metrics":17,"./Sleeping":20}],16:[function(require,module,exports){ /** * The `Matter.Events` module contains methods to fire and listen to events on other objects. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Events */ var Events = {}; module.exports = Events; var Common = require('./Common'); (function() { /** * Subscribes a callback function to the given object's `eventName`. * @method on * @param {} object * @param {string} eventNames * @param {function} callback */ Events.on = function(object, eventNames, callback) { var names = eventNames.split(' '), name; for (var i = 0; i < names.length; i++) { name = names[i]; object.events = object.events || {}; object.events[name] = object.events[name] || []; object.events[name].push(callback); } return callback; }; /** * Removes the given event callback. If no callback, clears all callbacks in `eventNames`. If no `eventNames`, clears all events. * @method off * @param {} object * @param {string} eventNames * @param {function} callback */ Events.off = function(object, eventNames, callback) { if (!eventNames) { object.events = {}; return; } // handle Events.off(object, callback) if (typeof eventNames === 'function') { callback = eventNames; eventNames = Common.keys(object.events).join(' '); } var names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { var callbacks = object.events[names[i]], newCallbacks = []; if (callback && callbacks) { for (var j = 0; j < callbacks.length; j++) { if (callbacks[j] !== callback) newCallbacks.push(callbacks[j]); } } object.events[names[i]] = newCallbacks; } }; /** * Fires all the callbacks subscribed to the given object's `eventName`, in the order they subscribed, if any. * @method trigger * @param {} object * @param {string} eventNames * @param {} event */ Events.trigger = function(object, eventNames, event) { var names, name, callbacks, eventClone; if (object.events) { if (!event) event = {}; names = eventNames.split(' '); for (var i = 0; i < names.length; i++) { name = names[i]; callbacks = object.events[name]; if (callbacks) { eventClone = Common.clone(event, false); eventClone.name = name; eventClone.source = object; for (var j = 0; j < callbacks.length; j++) { callbacks[j].apply(object, [eventClone]); } } } } }; })(); },{"./Common":14}],17:[function(require,module,exports){ },{"../body/Composite":2,"./Common":14}],18:[function(require,module,exports){ /** * The `Matter.Mouse` module contains methods for creating and manipulating mouse inputs. * * @class Mouse */ var Mouse = {}; module.exports = Mouse; var Common = require('../core/Common'); (function() { /** * Creates a mouse input. * @method create * @param {HTMLElement} element * @return {mouse} A new mouse */ Mouse.create = function(element) { var mouse = {}; if (!element) { Common.log('Mouse.create: element was undefined, defaulting to document.body', 'warn'); } mouse.element = element || document.body; mouse.absolute = { x: 0, y: 0 }; mouse.position = { x: 0, y: 0 }; mouse.mousedownPosition = { x: 0, y: 0 }; mouse.mouseupPosition = { x: 0, y: 0 }; mouse.offset = { x: 0, y: 0 }; mouse.scale = { x: 1, y: 1 }; mouse.wheelDelta = 0; mouse.button = -1; mouse.pixelRatio = mouse.element.getAttribute('data-pixel-ratio') || 1; mouse.sourceEvents = { mousemove: null, mousedown: null, mouseup: null, mousewheel: null }; mouse.mousemove = function(event) { var position = _getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.sourceEvents.mousemove = event; }; mouse.mousedown = function(event) { var position = _getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), touches = event.changedTouches; if (touches) { mouse.button = 0; event.preventDefault(); } else { mouse.button = event.button; } mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.mousedownPosition.x = mouse.position.x; mouse.mousedownPosition.y = mouse.position.y; mouse.sourceEvents.mousedown = event; }; mouse.mouseup = function(event) { var position = _getRelativeMousePosition(event, mouse.element, mouse.pixelRatio), touches = event.changedTouches; if (touches) { event.preventDefault(); } mouse.button = -1; mouse.absolute.x = position.x; mouse.absolute.y = position.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; mouse.mouseupPosition.x = mouse.position.x; mouse.mouseupPosition.y = mouse.position.y; mouse.sourceEvents.mouseup = event; }; mouse.mousewheel = function(event) { mouse.wheelDelta = Math.max(-1, Math.min(1, event.wheelDelta || -event.detail)); event.preventDefault(); }; Mouse.setElement(mouse, mouse.element); return mouse; }; /** * Sets the element the mouse is bound to (and relative to). * @method setElement * @param {mouse} mouse * @param {HTMLElement} element */ Mouse.setElement = function(mouse, element) { mouse.element = element; element.addEventListener('mousemove', mouse.mousemove); element.addEventListener('mousedown', mouse.mousedown); element.addEventListener('mouseup', mouse.mouseup); element.addEventListener('mousewheel', mouse.mousewheel); element.addEventListener('DOMMouseScroll', mouse.mousewheel); element.addEventListener('touchmove', mouse.mousemove); element.addEventListener('touchstart', mouse.mousedown); element.addEventListener('touchend', mouse.mouseup); }; /** * Clears all captured source events. * @method clearSourceEvents * @param {mouse} mouse */ Mouse.clearSourceEvents = function(mouse) { mouse.sourceEvents.mousemove = null; mouse.sourceEvents.mousedown = null; mouse.sourceEvents.mouseup = null; mouse.sourceEvents.mousewheel = null; mouse.wheelDelta = 0; }; /** * Sets the mouse position offset. * @method setOffset * @param {mouse} mouse * @param {vector} offset */ Mouse.setOffset = function(mouse, offset) { mouse.offset.x = offset.x; mouse.offset.y = offset.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; }; /** * Sets the mouse position scale. * @method setScale * @param {mouse} mouse * @param {vector} scale */ Mouse.setScale = function(mouse, scale) { mouse.scale.x = scale.x; mouse.scale.y = scale.y; mouse.position.x = mouse.absolute.x * mouse.scale.x + mouse.offset.x; mouse.position.y = mouse.absolute.y * mouse.scale.y + mouse.offset.y; }; /** * Gets the mouse position relative to an element given a screen pixel ratio. * @method _getRelativeMousePosition * @private * @param {} event * @param {} element * @param {number} pixelRatio * @return {} */ var _getRelativeMousePosition = function(event, element, pixelRatio) { var elementBounds = element.getBoundingClientRect(), rootNode = (document.documentElement || document.body.parentNode || document.body), scrollX = (window.pageXOffset !== undefined) ? window.pageXOffset : rootNode.scrollLeft, scrollY = (window.pageYOffset !== undefined) ? window.pageYOffset : rootNode.scrollTop, touches = event.changedTouches, x, y; if (touches) { x = touches[0].pageX - elementBounds.left - scrollX; y = touches[0].pageY - elementBounds.top - scrollY; } else { x = event.pageX - elementBounds.left - scrollX; y = event.pageY - elementBounds.top - scrollY; } return { x: x / (element.clientWidth / element.width * pixelRatio), y: y / (element.clientHeight / element.height * pixelRatio) }; }; })(); },{"../core/Common":14}],19:[function(require,module,exports){ /** * The `Matter.Runner` module is an optional utility which provides a game loop, * that handles continuously updating a `Matter.Engine` for you within a browser. * It is intended for development and debugging purposes, but may also be suitable for simple games. * If you are using your own game loop instead, then you do not need the `Matter.Runner` module. * Instead just call `Engine.update(engine, delta)` in your own loop. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Runner */ var Runner = {}; module.exports = Runner; var Events = require('./Events'); var Engine = require('./Engine'); var Common = require('./Common'); (function() { var _requestAnimationFrame, _cancelAnimationFrame; if (typeof window !== 'undefined') { _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || function(callback){ window.setTimeout(function() { callback(Common.now()); }, 1000 / 60); }; _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; } /** * Creates a new Runner. The options parameter is an object that specifies any properties you wish to override the defaults. * @method create * @param {} options */ Runner.create = function(options) { var defaults = { fps: 60, correction: 1, deltaSampleSize: 60, counterTimestamp: 0, frameCounter: 0, deltaHistory: [], timePrev: null, timeScalePrev: 1, frameRequestId: null, isFixed: false, enabled: true }; var runner = Common.extend(defaults, options); runner.delta = runner.delta || 1000 / runner.fps; runner.deltaMin = runner.deltaMin || 1000 / runner.fps; runner.deltaMax = runner.deltaMax || 1000 / (runner.fps * 0.5); runner.fps = 1000 / runner.delta; return runner; }; /** * Continuously ticks a `Matter.Engine` by calling `Runner.tick` on the `requestAnimationFrame` event. * @method run * @param {engine} engine */ Runner.run = function(runner, engine) { // create runner if engine is first argument if (typeof runner.positionIterations !== 'undefined') { engine = runner; runner = Runner.create(); } (function render(time){ runner.frameRequestId = _requestAnimationFrame(render); if (time && runner.enabled) { Runner.tick(runner, engine, time); } })(); return runner; }; /** * A game loop utility that updates the engine and renderer by one step (a 'tick'). * Features delta smoothing, time correction and fixed or dynamic timing. * Triggers `beforeTick`, `tick` and `afterTick` events on the engine. * Consider just `Engine.update(engine, delta)` if you're using your own loop. * @method tick * @param {runner} runner * @param {engine} engine * @param {number} time */ Runner.tick = function(runner, engine, time) { var timing = engine.timing, correction = 1, delta; // create an event object var event = { timestamp: timing.timestamp }; Events.trigger(runner, 'beforeTick', event); Events.trigger(engine, 'beforeTick', event); // @deprecated if (runner.isFixed) { // fixed timestep delta = runner.delta; } else { // dynamic timestep based on wall clock between calls delta = (time - runner.timePrev) || runner.delta; runner.timePrev = time; // optimistically filter delta over a few frames, to improve stability runner.deltaHistory.push(delta); runner.deltaHistory = runner.deltaHistory.slice(-runner.deltaSampleSize); delta = Math.min.apply(null, runner.deltaHistory); // limit delta delta = delta < runner.deltaMin ? runner.deltaMin : delta; delta = delta > runner.deltaMax ? runner.deltaMax : delta; // correction for delta correction = delta / runner.delta; // update engine timing object runner.delta = delta; } // time correction for time scaling if (runner.timeScalePrev !== 0) correction *= timing.timeScale / runner.timeScalePrev; if (timing.timeScale === 0) correction = 0; runner.timeScalePrev = timing.timeScale; runner.correction = correction; // fps counter runner.frameCounter += 1; if (time - runner.counterTimestamp >= 1000) { runner.fps = runner.frameCounter * ((time - runner.counterTimestamp) / 1000); runner.counterTimestamp = time; runner.frameCounter = 0; } Events.trigger(runner, 'tick', event); Events.trigger(engine, 'tick', event); // @deprecated // if world has been modified, clear the render scene graph if (engine.world.isModified && engine.render && engine.render.controller && engine.render.controller.clear) { engine.render.controller.clear(engine.render); } // update Events.trigger(runner, 'beforeUpdate', event); Engine.update(engine, delta, correction); Events.trigger(runner, 'afterUpdate', event); // render // @deprecated if (engine.render && engine.render.controller) { Events.trigger(runner, 'beforeRender', event); Events.trigger(engine, 'beforeRender', event); // @deprecated engine.render.controller.world(engine.render); Events.trigger(runner, 'afterRender', event); Events.trigger(engine, 'afterRender', event); // @deprecated } Events.trigger(runner, 'afterTick', event); Events.trigger(engine, 'afterTick', event); // @deprecated }; /** * Ends execution of `Runner.run` on the given `runner`, by canceling the animation frame request event loop. * If you wish to only temporarily pause the engine, see `engine.enabled` instead. * @method stop * @param {runner} runner */ Runner.stop = function(runner) { _cancelAnimationFrame(runner.frameRequestId); }; /** * Alias for `Runner.run`. * @method start * @param {runner} runner * @param {engine} engine */ Runner.start = function(runner, engine) { Runner.run(runner, engine); }; /* * * Events Documentation * */ /** * Fired at the start of a tick, before any updates to the engine or timing * * @event beforeTick * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after engine timing updated, but just before update * * @event tick * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired at the end of a tick, after engine update and after rendering * * @event afterTick * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired before update * * @event beforeUpdate * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after update * * @event afterUpdate * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired before rendering * * @event beforeRender * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event * @deprecated */ /** * Fired after rendering * * @event afterRender * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event * @deprecated */ /* * * Properties Documentation * */ /** * A flag that specifies whether the runner is running or not. * * @property enabled * @type boolean * @default true */ /** * A `Boolean` that specifies if the runner should use a fixed timestep (otherwise it is variable). * If timing is fixed, then the apparent simulation speed will change depending on the frame rate (but behaviour will be deterministic). * If the timing is variable, then the apparent simulation speed will be constant (approximately, but at the cost of determininism). * * @property isFixed * @type boolean * @default false */ /** * A `Number` that specifies the time step between updates in milliseconds. * If `engine.timing.isFixed` is set to `true`, then `delta` is fixed. * If it is `false`, then `delta` can dynamically change to maintain the correct apparent simulation speed. * * @property delta * @type number * @default 1000 / 60 */ })(); },{"./Common":14,"./Engine":15,"./Events":16}],20:[function(require,module,exports){ /** * The `Matter.Sleeping` module contains methods to manage the sleeping state of bodies. * * @class Sleeping */ var Sleeping = {}; module.exports = Sleeping; var Events = require('./Events'); (function() { Sleeping._motionWakeThreshold = 0.18; Sleeping._motionSleepThreshold = 0.08; Sleeping._minBias = 0.9; /** * Puts bodies to sleep or wakes them up depending on their motion. * @method update * @param {body[]} bodies * @param {number} timeScale */ Sleeping.update = function(bodies, timeScale) { var timeFactor = timeScale * timeScale * timeScale; // update bodies sleeping status for (var i = 0; i < bodies.length; i++) { var body = bodies[i], motion = body.speed * body.speed + body.angularSpeed * body.angularSpeed; // wake up bodies if they have a force applied if (body.force.x !== 0 || body.force.y !== 0) { Sleeping.set(body, false); continue; } var minMotion = Math.min(body.motion, motion), maxMotion = Math.max(body.motion, motion); // biased average motion estimation between frames body.motion = Sleeping._minBias * minMotion + (1 - Sleeping._minBias) * maxMotion; if (body.sleepThreshold > 0 && body.motion < Sleeping._motionSleepThreshold * timeFactor) { body.sleepCounter += 1; if (body.sleepCounter >= body.sleepThreshold) Sleeping.set(body, true); } else if (body.sleepCounter > 0) { body.sleepCounter -= 1; } } }; /** * Given a set of colliding pairs, wakes the sleeping bodies involved. * @method afterCollisions * @param {pair[]} pairs * @param {number} timeScale */ Sleeping.afterCollisions = function(pairs, timeScale) { var timeFactor = timeScale * timeScale * timeScale; // wake up bodies involved in collisions for (var i = 0; i < pairs.length; i++) { var pair = pairs[i]; // don't wake inactive pairs if (!pair.isActive) continue; var collision = pair.collision, bodyA = collision.bodyA.parent, bodyB = collision.bodyB.parent; // don't wake if at least one body is static if ((bodyA.isSleeping && bodyB.isSleeping) || bodyA.isStatic || bodyB.isStatic) continue; if (bodyA.isSleeping || bodyB.isSleeping) { var sleepingBody = (bodyA.isSleeping && !bodyA.isStatic) ? bodyA : bodyB, movingBody = sleepingBody === bodyA ? bodyB : bodyA; if (!sleepingBody.isStatic && movingBody.motion > Sleeping._motionWakeThreshold * timeFactor) { Sleeping.set(sleepingBody, false); } } } }; /** * Set a body as sleeping or awake. * @method set * @param {body} body * @param {boolean} isSleeping */ Sleeping.set = function(body, isSleeping) { var wasSleeping = body.isSleeping; if (isSleeping) { body.isSleeping = true; body.sleepCounter = body.sleepThreshold; body.positionImpulse.x = 0; body.positionImpulse.y = 0; body.positionPrev.x = body.position.x; body.positionPrev.y = body.position.y; body.anglePrev = body.angle; body.speed = 0; body.angularSpeed = 0; body.motion = 0; if (!wasSleeping) { Events.trigger(body, 'sleepStart'); } } else { body.isSleeping = false; body.sleepCounter = 0; if (wasSleeping) { Events.trigger(body, 'sleepEnd'); } } }; })(); },{"./Events":16}],21:[function(require,module,exports){ /** * The `Matter.Bodies` module contains factory methods for creating rigid body models * with commonly used body configurations (such as rectangles, circles and other polygons). * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Bodies */ // TODO: true circle bodies var Bodies = {}; module.exports = Bodies; var Vertices = require('../geometry/Vertices'); var Common = require('../core/Common'); var Body = require('../body/Body'); var Bounds = require('../geometry/Bounds'); var Vector = require('../geometry/Vector'); (function() { /** * Creates a new rigid body model with a rectangle hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method rectangle * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {object} [options] * @return {body} A new rectangle body */ Bodies.rectangle = function(x, y, width, height, options) { options = options || {}; var rectangle = { label: 'Rectangle Body', position: { x: x, y: y }, vertices: Vertices.fromPath('L 0 0 L ' + width + ' 0 L ' + width + ' ' + height + ' L 0 ' + height) }; if (options.chamfer) { var chamfer = options.chamfer; rectangle.vertices = Vertices.chamfer(rectangle.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, rectangle, options)); }; /** * Creates a new rigid body model with a trapezoid hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method trapezoid * @param {number} x * @param {number} y * @param {number} width * @param {number} height * @param {number} slope * @param {object} [options] * @return {body} A new trapezoid body */ Bodies.trapezoid = function(x, y, width, height, slope, options) { options = options || {}; slope *= 0.5; var roof = (1 - (slope * 2)) * width; var x1 = width * slope, x2 = x1 + roof, x3 = x2 + x1, verticesPath; if (slope < 0.5) { verticesPath = 'L 0 0 L ' + x1 + ' ' + (-height) + ' L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; } else { verticesPath = 'L 0 0 L ' + x2 + ' ' + (-height) + ' L ' + x3 + ' 0'; } var trapezoid = { label: 'Trapezoid Body', position: { x: x, y: y }, vertices: Vertices.fromPath(verticesPath) }; if (options.chamfer) { var chamfer = options.chamfer; trapezoid.vertices = Vertices.chamfer(trapezoid.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, trapezoid, options)); }; /** * Creates a new rigid body model with a circle hull. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method circle * @param {number} x * @param {number} y * @param {number} radius * @param {object} [options] * @param {number} [maxSides] * @return {body} A new circle body */ Bodies.circle = function(x, y, radius, options, maxSides) { options = options || {}; var circle = { label: 'Circle Body', circleRadius: radius }; // approximate circles with polygons until true circles implemented in SAT maxSides = maxSides || 25; var sides = Math.ceil(Math.max(10, Math.min(maxSides, radius))); // optimisation: always use even number of sides (half the number of unique axes) if (sides % 2 === 1) sides += 1; return Bodies.polygon(x, y, sides, radius, Common.extend({}, circle, options)); }; /** * Creates a new rigid body model with a regular polygon hull with the given number of sides. * The options parameter is an object that specifies any properties you wish to override the defaults. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method polygon * @param {number} x * @param {number} y * @param {number} sides * @param {number} radius * @param {object} [options] * @return {body} A new regular polygon body */ Bodies.polygon = function(x, y, sides, radius, options) { options = options || {}; if (sides < 3) return Bodies.circle(x, y, radius, options); var theta = 2 * Math.PI / sides, path = '', offset = theta * 0.5; for (var i = 0; i < sides; i += 1) { var angle = offset + (i * theta), xx = Math.cos(angle) * radius, yy = Math.sin(angle) * radius; path += 'L ' + xx.toFixed(3) + ' ' + yy.toFixed(3) + ' '; } var polygon = { label: 'Polygon Body', position: { x: x, y: y }, vertices: Vertices.fromPath(path) }; if (options.chamfer) { var chamfer = options.chamfer; polygon.vertices = Vertices.chamfer(polygon.vertices, chamfer.radius, chamfer.quality, chamfer.qualityMin, chamfer.qualityMax); delete options.chamfer; } return Body.create(Common.extend({}, polygon, options)); }; /** * Creates a body using the supplied vertices (or an array containing multiple sets of vertices). * If the vertices are convex, they will pass through as supplied. * Otherwise if the vertices are concave, they will be decomposed if [poly-decomp.js](https://github.com/schteppe/poly-decomp.js) is available. * Note that this process is not guaranteed to support complex sets of vertices (e.g. those with holes may fail). * By default the decomposition will discard collinear edges (to improve performance). * It can also optionally discard any parts that have an area less than `minimumArea`. * If the vertices can not be decomposed, the result will fall back to using the convex hull. * The options parameter is an object that specifies any `Matter.Body` properties you wish to override the defaults. * See the properties section of the `Matter.Body` module for detailed information on what you can pass via the `options` object. * @method fromVertices * @param {number} x * @param {number} y * @param [[vector]] vertexSets * @param {object} [options] * @param {bool} [flagInternal=false] * @param {number} [removeCollinear=0.01] * @param {number} [minimumArea=10] * @return {body} */ Bodies.fromVertices = function(x, y, vertexSets, options, flagInternal, removeCollinear, minimumArea) { var body, parts, isConvex, vertices, i, j, k, v, z; options = options || {}; parts = []; flagInternal = typeof flagInternal !== 'undefined' ? flagInternal : false; removeCollinear = typeof removeCollinear !== 'undefined' ? removeCollinear : 0.01; minimumArea = typeof minimumArea !== 'undefined' ? minimumArea : 10; if (!window.decomp) { Common.log('Bodies.fromVertices: poly-decomp.js required. Could not decompose vertices. Fallback to convex hull.', 'warn'); } // ensure vertexSets is an array of arrays if (!Common.isArray(vertexSets[0])) { vertexSets = [vertexSets]; } for (v = 0; v < vertexSets.length; v += 1) { vertices = vertexSets[v]; isConvex = Vertices.isConvex(vertices); if (isConvex || !window.decomp) { if (isConvex) { vertices = Vertices.clockwiseSort(vertices); } else { // fallback to convex hull when decomposition is not possible vertices = Vertices.hull(vertices); } parts.push({ position: { x: x, y: y }, vertices: vertices }); } else { // initialise a decomposition var concave = new decomp.Polygon(); for (i = 0; i < vertices.length; i++) { concave.vertices.push([vertices[i].x, vertices[i].y]); } // vertices are concave and simple, we can decompose into parts concave.makeCCW(); if (removeCollinear !== false) concave.removeCollinearPoints(removeCollinear); // use the quick decomposition algorithm (Bayazit) var decomposed = concave.quickDecomp(); // for each decomposed chunk for (i = 0; i < decomposed.length; i++) { var chunk = decomposed[i], chunkVertices = []; // convert vertices into the correct structure for (j = 0; j < chunk.vertices.length; j++) { chunkVertices.push({ x: chunk.vertices[j][0], y: chunk.vertices[j][1] }); } // skip small chunks if (minimumArea > 0 && Vertices.area(chunkVertices) < minimumArea) continue; // create a compound part parts.push({ position: Vertices.centre(chunkVertices), vertices: chunkVertices }); } } } // create body parts for (i = 0; i < parts.length; i++) { parts[i] = Body.create(Common.extend(parts[i], options)); } // flag internal edges (coincident part edges) if (flagInternal) { var coincident_max_dist = 5; for (i = 0; i < parts.length; i++) { var partA = parts[i]; for (j = i + 1; j < parts.length; j++) { var partB = parts[j]; if (Bounds.overlaps(partA.bounds, partB.bounds)) { var pav = partA.vertices, pbv = partB.vertices; // iterate vertices of both parts for (k = 0; k < partA.vertices.length; k++) { for (z = 0; z < partB.vertices.length; z++) { // find distances between the vertices var da = Vector.magnitudeSquared(Vector.sub(pav[(k + 1) % pav.length], pbv[z])), db = Vector.magnitudeSquared(Vector.sub(pav[k], pbv[(z + 1) % pbv.length])); // if both vertices are very close, consider the edge concident (internal) if (da < coincident_max_dist && db < coincident_max_dist) { pav[k].isInternal = true; pbv[z].isInternal = true; } } } } } } } if (parts.length > 1) { // create the parent body to be returned, that contains generated compound parts body = Body.create(Common.extend({ parts: parts.slice(0) }, options)); Body.setPosition(body, { x: x, y: y }); return body; } else { return parts[0]; } }; })(); },{"../body/Body":1,"../core/Common":14,"../geometry/Bounds":24,"../geometry/Vector":26,"../geometry/Vertices":27}],22:[function(require,module,exports){ /** * The `Matter.Composites` module contains factory methods for creating composite bodies * with commonly used configurations (such as stacks and chains). * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Composites */ var Composites = {}; module.exports = Composites; var Composite = require('../body/Composite'); var Constraint = require('../constraint/Constraint'); var Common = require('../core/Common'); var Body = require('../body/Body'); var Bodies = require('./Bodies'); (function() { /** * Create a new composite containing bodies created in the callback in a grid arrangement. * This function uses the body's bounds to prevent overlaps. * @method stack * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.stack = function(xx, yy, columns, rows, columnGap, rowGap, callback) { var stack = Composite.create({ label: 'Stack' }), x = xx, y = yy, lastBody, i = 0; for (var row = 0; row < rows; row++) { var maxHeight = 0; for (var column = 0; column < columns; column++) { var body = callback(x, y, column, row, lastBody, i); if (body) { var bodyHeight = body.bounds.max.y - body.bounds.min.y, bodyWidth = body.bounds.max.x - body.bounds.min.x; if (bodyHeight > maxHeight) maxHeight = bodyHeight; Body.translate(body, { x: bodyWidth * 0.5, y: bodyHeight * 0.5 }); x = body.bounds.max.x + columnGap; Composite.addBody(stack, body); lastBody = body; i += 1; } else { x += columnGap; } } y += maxHeight + rowGap; x = xx; } return stack; }; /** * Chains all bodies in the given composite together using constraints. * @method chain * @param {composite} composite * @param {number} xOffsetA * @param {number} yOffsetA * @param {number} xOffsetB * @param {number} yOffsetB * @param {object} options * @return {composite} A new composite containing objects chained together with constraints */ Composites.chain = function(composite, xOffsetA, yOffsetA, xOffsetB, yOffsetB, options) { var bodies = composite.bodies; for (var i = 1; i < bodies.length; i++) { var bodyA = bodies[i - 1], bodyB = bodies[i], bodyAHeight = bodyA.bounds.max.y - bodyA.bounds.min.y, bodyAWidth = bodyA.bounds.max.x - bodyA.bounds.min.x, bodyBHeight = bodyB.bounds.max.y - bodyB.bounds.min.y, bodyBWidth = bodyB.bounds.max.x - bodyB.bounds.min.x; var defaults = { bodyA: bodyA, pointA: { x: bodyAWidth * xOffsetA, y: bodyAHeight * yOffsetA }, bodyB: bodyB, pointB: { x: bodyBWidth * xOffsetB, y: bodyBHeight * yOffsetB } }; var constraint = Common.extend(defaults, options); Composite.addConstraint(composite, Constraint.create(constraint)); } composite.label += ' Chain'; return composite; }; /** * Connects bodies in the composite with constraints in a grid pattern, with optional cross braces. * @method mesh * @param {composite} composite * @param {number} columns * @param {number} rows * @param {boolean} crossBrace * @param {object} options * @return {composite} The composite containing objects meshed together with constraints */ Composites.mesh = function(composite, columns, rows, crossBrace, options) { var bodies = composite.bodies, row, col, bodyA, bodyB, bodyC; for (row = 0; row < rows; row++) { for (col = 1; col < columns; col++) { bodyA = bodies[(col - 1) + (row * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); } if (row > 0) { for (col = 0; col < columns; col++) { bodyA = bodies[col + ((row - 1) * columns)]; bodyB = bodies[col + (row * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyA, bodyB: bodyB }, options))); if (crossBrace && col > 0) { bodyC = bodies[(col - 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } if (crossBrace && col < columns - 1) { bodyC = bodies[(col + 1) + ((row - 1) * columns)]; Composite.addConstraint(composite, Constraint.create(Common.extend({ bodyA: bodyC, bodyB: bodyB }, options))); } } } } composite.label += ' Mesh'; return composite; }; /** * Create a new composite containing bodies created in the callback in a pyramid arrangement. * This function uses the body's bounds to prevent overlaps. * @method pyramid * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {function} callback * @return {composite} A new composite containing objects created in the callback */ Composites.pyramid = function(xx, yy, columns, rows, columnGap, rowGap, callback) { return Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y, column, row, lastBody, i) { var actualRows = Math.min(rows, Math.ceil(columns / 2)), lastBodyWidth = lastBody ? lastBody.bounds.max.x - lastBody.bounds.min.x : 0; if (row > actualRows) return; // reverse row order row = actualRows - row; var start = row, end = columns - 1 - row; if (column < start || column > end) return; // retroactively fix the first body's position, since width was unknown if (i === 1) { Body.translate(lastBody, { x: (column + (columns % 2 === 1 ? 1 : -1)) * lastBodyWidth, y: 0 }); } var xOffset = lastBody ? column * lastBodyWidth : 0; return callback(xx + xOffset + column * columnGap, y, column, row, lastBody, i); }); }; /** * Creates a composite with a Newton's Cradle setup of bodies and constraints. * @method newtonsCradle * @param {number} xx * @param {number} yy * @param {number} number * @param {number} size * @param {number} length * @return {composite} A new composite newtonsCradle body */ Composites.newtonsCradle = function(xx, yy, number, size, length) { var newtonsCradle = Composite.create({ label: 'Newtons Cradle' }); for (var i = 0; i < number; i++) { var separation = 1.9, circle = Bodies.circle(xx + i * (size * separation), yy + length, size, { inertia: Infinity, restitution: 1, friction: 0, frictionAir: 0.0001, slop: 1 }), constraint = Constraint.create({ pointA: { x: xx + i * (size * separation), y: yy }, bodyB: circle }); Composite.addBody(newtonsCradle, circle); Composite.addConstraint(newtonsCradle, constraint); } return newtonsCradle; }; /** * Creates a composite with simple car setup of bodies and constraints. * @method car * @param {number} xx * @param {number} yy * @param {number} width * @param {number} height * @param {number} wheelSize * @return {composite} A new composite car body */ Composites.car = function(xx, yy, width, height, wheelSize) { var group = Body.nextGroup(true), wheelBase = -20, wheelAOffset = -width * 0.5 + wheelBase, wheelBOffset = width * 0.5 - wheelBase, wheelYOffset = 0; var car = Composite.create({ label: 'Car' }), body = Bodies.trapezoid(xx, yy, width, height, 0.3, { collisionFilter: { group: group }, friction: 0.01, chamfer: { radius: 10 } }); var wheelA = Bodies.circle(xx + wheelAOffset, yy + wheelYOffset, wheelSize, { collisionFilter: { group: group }, friction: 0.8, density: 0.01 }); var wheelB = Bodies.circle(xx + wheelBOffset, yy + wheelYOffset, wheelSize, { collisionFilter: { group: group }, friction: 0.8, density: 0.01 }); var axelA = Constraint.create({ bodyA: body, pointA: { x: wheelAOffset, y: wheelYOffset }, bodyB: wheelA, stiffness: 0.2 }); var axelB = Constraint.create({ bodyA: body, pointA: { x: wheelBOffset, y: wheelYOffset }, bodyB: wheelB, stiffness: 0.2 }); Composite.addBody(car, body); Composite.addBody(car, wheelA); Composite.addBody(car, wheelB); Composite.addConstraint(car, axelA); Composite.addConstraint(car, axelB); return car; }; /** * Creates a simple soft body like object. * @method softBody * @param {number} xx * @param {number} yy * @param {number} columns * @param {number} rows * @param {number} columnGap * @param {number} rowGap * @param {boolean} crossBrace * @param {number} particleRadius * @param {} particleOptions * @param {} constraintOptions * @return {composite} A new composite softBody */ Composites.softBody = function(xx, yy, columns, rows, columnGap, rowGap, crossBrace, particleRadius, particleOptions, constraintOptions) { particleOptions = Common.extend({ inertia: Infinity }, particleOptions); constraintOptions = Common.extend({ stiffness: 0.4 }, constraintOptions); var softBody = Composites.stack(xx, yy, columns, rows, columnGap, rowGap, function(x, y) { return Bodies.circle(x, y, particleRadius, particleOptions); }); Composites.mesh(softBody, columns, rows, crossBrace, constraintOptions); softBody.label = 'Soft Body'; return softBody; }; })(); },{"../body/Body":1,"../body/Composite":2,"../constraint/Constraint":12,"../core/Common":14,"./Bodies":21}],23:[function(require,module,exports){ /** * The `Matter.Axes` module contains methods for creating and manipulating sets of axes. * * @class Axes */ var Axes = {}; module.exports = Axes; var Vector = require('../geometry/Vector'); var Common = require('../core/Common'); (function() { /** * Creates a new set of axes from the given vertices. * @method fromVertices * @param {vertices} vertices * @return {axes} A new axes from the given vertices */ Axes.fromVertices = function(vertices) { var axes = {}; // find the unique axes, using edge normal gradients for (var i = 0; i < vertices.length; i++) { var j = (i + 1) % vertices.length, normal = Vector.normalise({ x: vertices[j].y - vertices[i].y, y: vertices[i].x - vertices[j].x }), gradient = (normal.y === 0) ? Infinity : (normal.x / normal.y); // limit precision gradient = gradient.toFixed(3).toString(); axes[gradient] = normal; } return Common.values(axes); }; /** * Rotates a set of axes by the given angle. * @method rotate * @param {axes} axes * @param {number} angle */ Axes.rotate = function(axes, angle) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < axes.length; i++) { var axis = axes[i], xx; xx = axis.x * cos - axis.y * sin; axis.y = axis.x * sin + axis.y * cos; axis.x = xx; } }; })(); },{"../core/Common":14,"../geometry/Vector":26}],24:[function(require,module,exports){ /** * The `Matter.Bounds` module contains methods for creating and manipulating axis-aligned bounding boxes (AABB). * * @class Bounds */ var Bounds = {}; module.exports = Bounds; (function() { /** * Creates a new axis-aligned bounding box (AABB) for the given vertices. * @method create * @param {vertices} vertices * @return {bounds} A new bounds object */ Bounds.create = function(vertices) { var bounds = { min: { x: 0, y: 0 }, max: { x: 0, y: 0 } }; if (vertices) Bounds.update(bounds, vertices); return bounds; }; /** * Updates bounds using the given vertices and extends the bounds given a velocity. * @method update * @param {bounds} bounds * @param {vertices} vertices * @param {vector} velocity */ Bounds.update = function(bounds, vertices, velocity) { bounds.min.x = Infinity; bounds.max.x = -Infinity; bounds.min.y = Infinity; bounds.max.y = -Infinity; for (var i = 0; i < vertices.length; i++) { var vertex = vertices[i]; if (vertex.x > bounds.max.x) bounds.max.x = vertex.x; if (vertex.x < bounds.min.x) bounds.min.x = vertex.x; if (vertex.y > bounds.max.y) bounds.max.y = vertex.y; if (vertex.y < bounds.min.y) bounds.min.y = vertex.y; } if (velocity) { if (velocity.x > 0) { bounds.max.x += velocity.x; } else { bounds.min.x += velocity.x; } if (velocity.y > 0) { bounds.max.y += velocity.y; } else { bounds.min.y += velocity.y; } } }; /** * Returns true if the bounds contains the given point. * @method contains * @param {bounds} bounds * @param {vector} point * @return {boolean} True if the bounds contain the point, otherwise false */ Bounds.contains = function(bounds, point) { return point.x >= bounds.min.x && point.x <= bounds.max.x && point.y >= bounds.min.y && point.y <= bounds.max.y; }; /** * Returns true if the two bounds intersect. * @method overlaps * @param {bounds} boundsA * @param {bounds} boundsB * @return {boolean} True if the bounds overlap, otherwise false */ Bounds.overlaps = function(boundsA, boundsB) { return (boundsA.min.x <= boundsB.max.x && boundsA.max.x >= boundsB.min.x && boundsA.max.y >= boundsB.min.y && boundsA.min.y <= boundsB.max.y); }; /** * Translates the bounds by the given vector. * @method translate * @param {bounds} bounds * @param {vector} vector */ Bounds.translate = function(bounds, vector) { bounds.min.x += vector.x; bounds.max.x += vector.x; bounds.min.y += vector.y; bounds.max.y += vector.y; }; /** * Shifts the bounds to the given position. * @method shift * @param {bounds} bounds * @param {vector} position */ Bounds.shift = function(bounds, position) { var deltaX = bounds.max.x - bounds.min.x, deltaY = bounds.max.y - bounds.min.y; bounds.min.x = position.x; bounds.max.x = position.x + deltaX; bounds.min.y = position.y; bounds.max.y = position.y + deltaY; }; })(); },{}],25:[function(require,module,exports){ /** * The `Matter.Svg` module contains methods for converting SVG images into an array of vector points. * * To use this module you also need the SVGPathSeg polyfill: https://github.com/progers/pathseg * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Svg */ var Svg = {}; module.exports = Svg; var Bounds = require('../geometry/Bounds'); (function() { /** * Converts an SVG path into an array of vector points. * If the input path forms a concave shape, you must decompose the result into convex parts before use. * See `Bodies.fromVertices` which provides support for this. * Note that this function is not guaranteed to support complex paths (such as those with holes). * @method pathToVertices * @param {SVGPathElement} path * @param {Number} [sampleLength=15] * @return {Vector[]} points */ Svg.pathToVertices = function(path, sampleLength) { // https://github.com/wout/svg.topoly.js/blob/master/svg.topoly.js var i, il, total, point, segment, segments, segmentsQueue, lastSegment, lastPoint, segmentIndex, points = [], lx, ly, length = 0, x = 0, y = 0; sampleLength = sampleLength || 15; var addPoint = function(px, py, pathSegType) { // all odd-numbered path types are relative except PATHSEG_CLOSEPATH (1) var isRelative = pathSegType % 2 === 1 && pathSegType > 1; // when the last point doesn't equal the current point add the current point if (!lastPoint || px != lastPoint.x || py != lastPoint.y) { if (lastPoint && isRelative) { lx = lastPoint.x; ly = lastPoint.y; } else { lx = 0; ly = 0; } var point = { x: lx + px, y: ly + py }; // set last point if (isRelative || !lastPoint) { lastPoint = point; } points.push(point); x = lx + px; y = ly + py; } }; var addSegmentPoint = function(segment) { var segType = segment.pathSegTypeAsLetter.toUpperCase(); // skip path ends if (segType === 'Z') return; // map segment to x and y switch (segType) { case 'M': case 'L': case 'T': case 'C': case 'S': case 'Q': x = segment.x; y = segment.y; break; case 'H': x = segment.x; break; case 'V': y = segment.y; break; } addPoint(x, y, segment.pathSegType); }; // ensure path is absolute _svgPathToAbsolute(path); // get total length total = path.getTotalLength(); // queue segments segments = []; for (i = 0; i < path.pathSegList.numberOfItems; i += 1) segments.push(path.pathSegList.getItem(i)); segmentsQueue = segments.concat(); // sample through path while (length < total) { // get segment at position segmentIndex = path.getPathSegAtLength(length); segment = segments[segmentIndex]; // new segment if (segment != lastSegment) { while (segmentsQueue.length && segmentsQueue[0] != segment) addSegmentPoint(segmentsQueue.shift()); lastSegment = segment; } // add points in between when curving // TODO: adaptive sampling switch (segment.pathSegTypeAsLetter.toUpperCase()) { case 'C': case 'T': case 'S': case 'Q': case 'A': point = path.getPointAtLength(length); addPoint(point.x, point.y, 0); break; } // increment by sample value length += sampleLength; } // add remaining segments not passed by sampling for (i = 0, il = segmentsQueue.length; i < il; ++i) addSegmentPoint(segmentsQueue[i]); return points; }; var _svgPathToAbsolute = function(path) { // http://phrogz.net/convert-svg-path-to-all-absolute-commands var x0, y0, x1, y1, x2, y2, segs = path.pathSegList, x = 0, y = 0, len = segs.numberOfItems; for (var i = 0; i < len; ++i) { var seg = segs.getItem(i), segType = seg.pathSegTypeAsLetter; if (/[MLHVCSQTA]/.test(segType)) { if ('x' in seg) x = seg.x; if ('y' in seg) y = seg.y; } else { if ('x1' in seg) x1 = x + seg.x1; if ('x2' in seg) x2 = x + seg.x2; if ('y1' in seg) y1 = y + seg.y1; if ('y2' in seg) y2 = y + seg.y2; if ('x' in seg) x += seg.x; if ('y' in seg) y += seg.y; switch (segType) { case 'm': segs.replaceItem(path.createSVGPathSegMovetoAbs(x, y), i); break; case 'l': segs.replaceItem(path.createSVGPathSegLinetoAbs(x, y), i); break; case 'h': segs.replaceItem(path.createSVGPathSegLinetoHorizontalAbs(x), i); break; case 'v': segs.replaceItem(path.createSVGPathSegLinetoVerticalAbs(y), i); break; case 'c': segs.replaceItem(path.createSVGPathSegCurvetoCubicAbs(x, y, x1, y1, x2, y2), i); break; case 's': segs.replaceItem(path.createSVGPathSegCurvetoCubicSmoothAbs(x, y, x2, y2), i); break; case 'q': segs.replaceItem(path.createSVGPathSegCurvetoQuadraticAbs(x, y, x1, y1), i); break; case 't': segs.replaceItem(path.createSVGPathSegCurvetoQuadraticSmoothAbs(x, y), i); break; case 'a': segs.replaceItem(path.createSVGPathSegArcAbs(x, y, seg.r1, seg.r2, seg.angle, seg.largeArcFlag, seg.sweepFlag), i); break; case 'z': case 'Z': x = x0; y = y0; break; } } if (segType == 'M' || segType == 'm') { x0 = x; y0 = y; } } }; })(); },{"../geometry/Bounds":24}],26:[function(require,module,exports){ /** * The `Matter.Vector` module contains methods for creating and manipulating vectors. * Vectors are the basis of all the geometry related operations in the engine. * A `Matter.Vector` object is of the form `{ x: 0, y: 0 }`. * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Vector */ // TODO: consider params for reusing vector objects var Vector = {}; module.exports = Vector; (function() { /** * Creates a new vector. * @method create * @param {number} x * @param {number} y * @return {vector} A new vector */ Vector.create = function(x, y) { return { x: x || 0, y: y || 0 }; }; /** * Returns a new vector with `x` and `y` copied from the given `vector`. * @method clone * @param {vector} vector * @return {vector} A new cloned vector */ Vector.clone = function(vector) { return { x: vector.x, y: vector.y }; }; /** * Returns the magnitude (length) of a vector. * @method magnitude * @param {vector} vector * @return {number} The magnitude of the vector */ Vector.magnitude = function(vector) { return Math.sqrt((vector.x * vector.x) + (vector.y * vector.y)); }; /** * Returns the magnitude (length) of a vector (therefore saving a `sqrt` operation). * @method magnitudeSquared * @param {vector} vector * @return {number} The squared magnitude of the vector */ Vector.magnitudeSquared = function(vector) { return (vector.x * vector.x) + (vector.y * vector.y); }; /** * Rotates the vector about (0, 0) by specified angle. * @method rotate * @param {vector} vector * @param {number} angle * @return {vector} A new vector rotated about (0, 0) */ Vector.rotate = function(vector, angle) { var cos = Math.cos(angle), sin = Math.sin(angle); return { x: vector.x * cos - vector.y * sin, y: vector.x * sin + vector.y * cos }; }; /** * Rotates the vector about a specified point by specified angle. * @method rotateAbout * @param {vector} vector * @param {number} angle * @param {vector} point * @param {vector} [output] * @return {vector} A new vector rotated about the point */ Vector.rotateAbout = function(vector, angle, point, output) { var cos = Math.cos(angle), sin = Math.sin(angle); if (!output) output = {}; var x = point.x + ((vector.x - point.x) * cos - (vector.y - point.y) * sin); output.y = point.y + ((vector.x - point.x) * sin + (vector.y - point.y) * cos); output.x = x; return output; }; /** * Normalises a vector (such that its magnitude is `1`). * @method normalise * @param {vector} vector * @return {vector} A new vector normalised */ Vector.normalise = function(vector) { var magnitude = Vector.magnitude(vector); if (magnitude === 0) return { x: 0, y: 0 }; return { x: vector.x / magnitude, y: vector.y / magnitude }; }; /** * Returns the dot-product of two vectors. * @method dot * @param {vector} vectorA * @param {vector} vectorB * @return {number} The dot product of the two vectors */ Vector.dot = function(vectorA, vectorB) { return (vectorA.x * vectorB.x) + (vectorA.y * vectorB.y); }; /** * Returns the cross-product of two vectors. * @method cross * @param {vector} vectorA * @param {vector} vectorB * @return {number} The cross product of the two vectors */ Vector.cross = function(vectorA, vectorB) { return (vectorA.x * vectorB.y) - (vectorA.y * vectorB.x); }; /** * Returns the cross-product of three vectors. * @method cross3 * @param {vector} vectorA * @param {vector} vectorB * @param {vector} vectorC * @return {number} The cross product of the three vectors */ Vector.cross3 = function(vectorA, vectorB, vectorC) { return (vectorB.x - vectorA.x) * (vectorC.y - vectorA.y) - (vectorB.y - vectorA.y) * (vectorC.x - vectorA.x); }; /** * Adds the two vectors. * @method add * @param {vector} vectorA * @param {vector} vectorB * @param {vector} [output] * @return {vector} A new vector of vectorA and vectorB added */ Vector.add = function(vectorA, vectorB, output) { if (!output) output = {}; output.x = vectorA.x + vectorB.x; output.y = vectorA.y + vectorB.y; return output; }; /** * Subtracts the two vectors. * @method sub * @param {vector} vectorA * @param {vector} vectorB * @param {vector} [output] * @return {vector} A new vector of vectorA and vectorB subtracted */ Vector.sub = function(vectorA, vectorB, output) { if (!output) output = {}; output.x = vectorA.x - vectorB.x; output.y = vectorA.y - vectorB.y; return output; }; /** * Multiplies a vector and a scalar. * @method mult * @param {vector} vector * @param {number} scalar * @return {vector} A new vector multiplied by scalar */ Vector.mult = function(vector, scalar) { return { x: vector.x * scalar, y: vector.y * scalar }; }; /** * Divides a vector and a scalar. * @method div * @param {vector} vector * @param {number} scalar * @return {vector} A new vector divided by scalar */ Vector.div = function(vector, scalar) { return { x: vector.x / scalar, y: vector.y / scalar }; }; /** * Returns the perpendicular vector. Set `negate` to true for the perpendicular in the opposite direction. * @method perp * @param {vector} vector * @param {bool} [negate=false] * @return {vector} The perpendicular vector */ Vector.perp = function(vector, negate) { negate = negate === true ? -1 : 1; return { x: negate * -vector.y, y: negate * vector.x }; }; /** * Negates both components of a vector such that it points in the opposite direction. * @method neg * @param {vector} vector * @return {vector} The negated vector */ Vector.neg = function(vector) { return { x: -vector.x, y: -vector.y }; }; /** * Returns the angle in radians between the two vectors relative to the x-axis. * @method angle * @param {vector} vectorA * @param {vector} vectorB * @return {number} The angle in radians */ Vector.angle = function(vectorA, vectorB) { return Math.atan2(vectorB.y - vectorA.y, vectorB.x - vectorA.x); }; /** * Temporary vector pool (not thread-safe). * @property _temp * @type {vector[]} * @private */ Vector._temp = [Vector.create(), Vector.create(), Vector.create(), Vector.create(), Vector.create(), Vector.create()]; })(); },{}],27:[function(require,module,exports){ /** * The `Matter.Vertices` module contains methods for creating and manipulating sets of vertices. * A set of vertices is an array of `Matter.Vector` with additional indexing properties inserted by `Vertices.create`. * A `Matter.Body` maintains a set of vertices to represent the shape of the object (its convex hull). * * See the included usage [examples](https://github.com/liabru/matter-js/tree/master/examples). * * @class Vertices */ var Vertices = {}; module.exports = Vertices; var Vector = require('../geometry/Vector'); var Common = require('../core/Common'); (function() { /** * Creates a new set of `Matter.Body` compatible vertices. * The `points` argument accepts an array of `Matter.Vector` points orientated around the origin `(0, 0)`, for example: * * [{ x: 0, y: 0 }, { x: 25, y: 50 }, { x: 50, y: 0 }] * * The `Vertices.create` method returns a new array of vertices, which are similar to Matter.Vector objects, * but with some additional references required for efficient collision detection routines. * * Note that the `body` argument is not optional, a `Matter.Body` reference must be provided. * * @method create * @param {vector[]} points * @param {body} body */ Vertices.create = function(points, body) { var vertices = []; for (var i = 0; i < points.length; i++) { var point = points[i], vertex = { x: point.x, y: point.y, index: i, body: body, isInternal: false }; vertices.push(vertex); } return vertices; }; /** * Parses a string containing ordered x y pairs separated by spaces (and optionally commas), * into a `Matter.Vertices` object for the given `Matter.Body`. * For parsing SVG paths, see `Svg.pathToVertices`. * @method fromPath * @param {string} path * @param {body} body * @return {vertices} vertices */ Vertices.fromPath = function(path, body) { var pathPattern = /L?\s*([\-\d\.e]+)[\s,]*([\-\d\.e]+)*/ig, points = []; path.replace(pathPattern, function(match, x, y) { points.push({ x: parseFloat(x), y: parseFloat(y) }); }); return Vertices.create(points, body); }; /** * Returns the centre (centroid) of the set of vertices. * @method centre * @param {vertices} vertices * @return {vector} The centre point */ Vertices.centre = function(vertices) { var area = Vertices.area(vertices, true), centre = { x: 0, y: 0 }, cross, temp, j; for (var i = 0; i < vertices.length; i++) { j = (i + 1) % vertices.length; cross = Vector.cross(vertices[i], vertices[j]); temp = Vector.mult(Vector.add(vertices[i], vertices[j]), cross); centre = Vector.add(centre, temp); } return Vector.div(centre, 6 * area); }; /** * Returns the average (mean) of the set of vertices. * @method mean * @param {vertices} vertices * @return {vector} The average point */ Vertices.mean = function(vertices) { var average = { x: 0, y: 0 }; for (var i = 0; i < vertices.length; i++) { average.x += vertices[i].x; average.y += vertices[i].y; } return Vector.div(average, vertices.length); }; /** * Returns the area of the set of vertices. * @method area * @param {vertices} vertices * @param {bool} signed * @return {number} The area */ Vertices.area = function(vertices, signed) { var area = 0, j = vertices.length - 1; for (var i = 0; i < vertices.length; i++) { area += (vertices[j].x - vertices[i].x) * (vertices[j].y + vertices[i].y); j = i; } if (signed) return area / 2; return Math.abs(area) / 2; }; /** * Returns the moment of inertia (second moment of area) of the set of vertices given the total mass. * @method inertia * @param {vertices} vertices * @param {number} mass * @return {number} The polygon's moment of inertia */ Vertices.inertia = function(vertices, mass) { var numerator = 0, denominator = 0, v = vertices, cross, j; // find the polygon's moment of inertia, using second moment of area // http://www.physicsforums.com/showthread.php?t=25293 for (var n = 0; n < v.length; n++) { j = (n + 1) % v.length; cross = Math.abs(Vector.cross(v[j], v[n])); numerator += cross * (Vector.dot(v[j], v[j]) + Vector.dot(v[j], v[n]) + Vector.dot(v[n], v[n])); denominator += cross; } return (mass / 6) * (numerator / denominator); }; /** * Translates the set of vertices in-place. * @method translate * @param {vertices} vertices * @param {vector} vector * @param {number} scalar */ Vertices.translate = function(vertices, vector, scalar) { var i; if (scalar) { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x * scalar; vertices[i].y += vector.y * scalar; } } else { for (i = 0; i < vertices.length; i++) { vertices[i].x += vector.x; vertices[i].y += vector.y; } } return vertices; }; /** * Rotates the set of vertices in-place. * @method rotate * @param {vertices} vertices * @param {number} angle * @param {vector} point */ Vertices.rotate = function(vertices, angle, point) { if (angle === 0) return; var cos = Math.cos(angle), sin = Math.sin(angle); for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], dx = vertice.x - point.x, dy = vertice.y - point.y; vertice.x = point.x + (dx * cos - dy * sin); vertice.y = point.y + (dx * sin + dy * cos); } return vertices; }; /** * Returns `true` if the `point` is inside the set of `vertices`. * @method contains * @param {vertices} vertices * @param {vector} point * @return {boolean} True if the vertices contains point, otherwise false */ Vertices.contains = function(vertices, point) { for (var i = 0; i < vertices.length; i++) { var vertice = vertices[i], nextVertice = vertices[(i + 1) % vertices.length]; if ((point.x - vertice.x) * (nextVertice.y - vertice.y) + (point.y - vertice.y) * (vertice.x - nextVertice.x) > 0) { return false; } } return true; }; /** * Scales the vertices from a point (default is centre) in-place. * @method scale * @param {vertices} vertices * @param {number} scaleX * @param {number} scaleY * @param {vector} point */ Vertices.scale = function(vertices, scaleX, scaleY, point) { if (scaleX === 1 && scaleY === 1) return vertices; point = point || Vertices.centre(vertices); var vertex, delta; for (var i = 0; i < vertices.length; i++) { vertex = vertices[i]; delta = Vector.sub(vertex, point); vertices[i].x = point.x + delta.x * scaleX; vertices[i].y = point.y + delta.y * scaleY; } return vertices; }; /** * Chamfers a set of vertices by giving them rounded corners, returns a new set of vertices. * The radius parameter is a single number or an array to specify the radius for each vertex. * @method chamfer * @param {vertices} vertices * @param {number[]} radius * @param {number} quality * @param {number} qualityMin * @param {number} qualityMax */ Vertices.chamfer = function(vertices, radius, quality, qualityMin, qualityMax) { radius = radius || [8]; if (!radius.length) radius = [radius]; // quality defaults to -1, which is auto quality = (typeof quality !== 'undefined') ? quality : -1; qualityMin = qualityMin || 2; qualityMax = qualityMax || 14; var newVertices = []; for (var i = 0; i < vertices.length; i++) { var prevVertex = vertices[i - 1 >= 0 ? i - 1 : vertices.length - 1], vertex = vertices[i], nextVertex = vertices[(i + 1) % vertices.length], currentRadius = radius[i < radius.length ? i : radius.length - 1]; if (currentRadius === 0) { newVertices.push(vertex); continue; } var prevNormal = Vector.normalise({ x: vertex.y - prevVertex.y, y: prevVertex.x - vertex.x }); var nextNormal = Vector.normalise({ x: nextVertex.y - vertex.y, y: vertex.x - nextVertex.x }); var diagonalRadius = Math.sqrt(2 * Math.pow(currentRadius, 2)), radiusVector = Vector.mult(Common.clone(prevNormal), currentRadius), midNormal = Vector.normalise(Vector.mult(Vector.add(prevNormal, nextNormal), 0.5)), scaledVertex = Vector.sub(vertex, Vector.mult(midNormal, diagonalRadius)); var precision = quality; if (quality === -1) { // automatically decide precision precision = Math.pow(currentRadius, 0.32) * 1.75; } precision = Common.clamp(precision, qualityMin, qualityMax); // use an even value for precision, more likely to reduce axes by using symmetry if (precision % 2 === 1) precision += 1; var alpha = Math.acos(Vector.dot(prevNormal, nextNormal)), theta = alpha / precision; for (var j = 0; j < precision; j++) { newVertices.push(Vector.add(Vector.rotate(radiusVector, theta * j), scaledVertex)); } } return newVertices; }; /** * Sorts the input vertices into clockwise order in place. * @method clockwiseSort * @param {vertices} vertices * @return {vertices} vertices */ Vertices.clockwiseSort = function(vertices) { var centre = Vertices.mean(vertices); vertices.sort(function(vertexA, vertexB) { return Vector.angle(centre, vertexA) - Vector.angle(centre, vertexB); }); return vertices; }; /** * Returns true if the vertices form a convex shape (vertices must be in clockwise order). * @method isConvex * @param {vertices} vertices * @return {bool} `true` if the `vertices` are convex, `false` if not (or `null` if not computable). */ Vertices.isConvex = function(vertices) { // http://paulbourke.net/geometry/polygonmesh/ var flag = 0, n = vertices.length, i, j, k, z; if (n < 3) return null; for (i = 0; i < n; i++) { j = (i + 1) % n; k = (i + 2) % n; z = (vertices[j].x - vertices[i].x) * (vertices[k].y - vertices[j].y); z -= (vertices[j].y - vertices[i].y) * (vertices[k].x - vertices[j].x); if (z < 0) { flag |= 1; } else if (z > 0) { flag |= 2; } if (flag === 3) { return false; } } if (flag !== 0){ return true; } else { return null; } }; /** * Returns the convex hull of the input vertices as a new array of points. * @method hull * @param {vertices} vertices * @return [vertex] vertices */ Vertices.hull = function(vertices) { // http://en.wikibooks.org/wiki/Algorithm_Implementation/Geometry/Convex_hull/Monotone_chain var upper = [], lower = [], vertex, i; // sort vertices on x-axis (y-axis for ties) vertices = vertices.slice(0); vertices.sort(function(vertexA, vertexB) { var dx = vertexA.x - vertexB.x; return dx !== 0 ? dx : vertexA.y - vertexB.y; }); // build lower hull for (i = 0; i < vertices.length; i++) { vertex = vertices[i]; while (lower.length >= 2 && Vector.cross3(lower[lower.length - 2], lower[lower.length - 1], vertex) <= 0) { lower.pop(); } lower.push(vertex); } // build upper hull for (i = vertices.length - 1; i >= 0; i--) { vertex = vertices[i]; while (upper.length >= 2 && Vector.cross3(upper[upper.length - 2], upper[upper.length - 1], vertex) <= 0) { upper.pop(); } upper.push(vertex); } // concatenation of the lower and upper hulls gives the convex hull // omit last points because they are repeated at the beginning of the other list upper.pop(); lower.pop(); return upper.concat(lower); }; })(); },{"../core/Common":14,"../geometry/Vector":26}],28:[function(require,module,exports){ var Matter = module.exports = {}; window.Matter = Matter; Matter.version = 'master'; Matter.Body = require('../body/Body'); Matter.Composite = require('../body/Composite'); Matter.World = require('../body/World'); Matter.Contact = require('../collision/Contact'); Matter.Detector = require('../collision/Detector'); Matter.Grid = require('../collision/Grid'); Matter.Pairs = require('../collision/Pairs'); Matter.Pair = require('../collision/Pair'); Matter.Query = require('../collision/Query'); Matter.Resolver = require('../collision/Resolver'); Matter.SAT = require('../collision/SAT'); Matter.Constraint = require('../constraint/Constraint'); Matter.MouseConstraint = require('../constraint/MouseConstraint'); Matter.Common = require('../core/Common'); Matter.Engine = require('../core/Engine'); Matter.Events = require('../core/Events'); Matter.Mouse = require('../core/Mouse'); Matter.Runner = require('../core/Runner'); Matter.Sleeping = require('../core/Sleeping'); Matter.Bodies = require('../factory/Bodies'); Matter.Composites = require('../factory/Composites'); Matter.Axes = require('../geometry/Axes'); Matter.Bounds = require('../geometry/Bounds'); Matter.Svg = require('../geometry/Svg'); Matter.Vector = require('../geometry/Vector'); Matter.Vertices = require('../geometry/Vertices'); Matter.Render = require('../render/Render'); Matter.RenderPixi = require('../render/RenderPixi'); // aliases Matter.World.add = Matter.Composite.add; Matter.World.remove = Matter.Composite.remove; Matter.World.addComposite = Matter.Composite.addComposite; Matter.World.addBody = Matter.Composite.addBody; Matter.World.addConstraint = Matter.Composite.addConstraint; Matter.World.clear = Matter.Composite.clear; Matter.Engine.run = Matter.Runner.run; },{"../body/Body":1,"../body/Composite":2,"../body/World":3,"../collision/Contact":4,"../collision/Detector":5,"../collision/Grid":6,"../collision/Pair":7,"../collision/Pairs":8,"../collision/Query":9,"../collision/Resolver":10,"../collision/SAT":11,"../constraint/Constraint":12,"../constraint/MouseConstraint":13,"../core/Common":14,"../core/Engine":15,"../core/Events":16,"../core/Metrics":17,"../core/Mouse":18,"../core/Runner":19,"../core/Sleeping":20,"../factory/Bodies":21,"../factory/Composites":22,"../geometry/Axes":23,"../geometry/Bounds":24,"../geometry/Svg":25,"../geometry/Vector":26,"../geometry/Vertices":27,"../render/Render":29,"../render/RenderPixi":30}],29:[function(require,module,exports){ /** * The `Matter.Render` module is a simple HTML5 canvas based renderer for visualising instances of `Matter.Engine`. * It is intended for development and debugging purposes, but may also be suitable for simple games. * It includes a number of drawing options including wireframe, vector with support for sprites and viewports. * * @class Render */ var Render = {}; module.exports = Render; var Common = require('../core/Common'); var Composite = require('../body/Composite'); var Bounds = require('../geometry/Bounds'); var Events = require('../core/Events'); var Grid = require('../collision/Grid'); var Vector = require('../geometry/Vector'); (function() { var _requestAnimationFrame, _cancelAnimationFrame; if (typeof window !== 'undefined') { _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || function(callback){ window.setTimeout(function() { callback(Common.now()); }, 1000 / 60); }; _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; } /** * Creates a new renderer. The options parameter is an object that specifies any properties you wish to override the defaults. * All properties have default values, and many are pre-calculated automatically based on other properties. * See the properties section below for detailed information on what you can pass via the `options` object. * @method create * @param {object} [options] * @return {render} A new renderer */ Render.create = function(options) { var defaults = { controller: Render, engine: null, element: null, canvas: null, mouse: null, frameRequestId: null, options: { width: 800, height: 600, pixelRatio: 1, background: '#fafafa', wireframeBackground: '#222', hasBounds: !!options.bounds, enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showSeparations: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false, showVertexNumbers: false, showConvexHulls: false, showInternalEdges: false, showMousePosition: false } }; var render = Common.extend(defaults, options); if (render.canvas) { render.canvas.width = render.options.width || render.canvas.width; render.canvas.height = render.options.height || render.canvas.height; } render.mouse = options.mouse; render.engine = options.engine; render.canvas = render.canvas || _createCanvas(render.options.width, render.options.height); render.context = render.canvas.getContext('2d'); render.textures = {}; render.bounds = render.bounds || { min: { x: 0, y: 0 }, max: { x: render.canvas.width, y: render.canvas.height } }; if (render.options.pixelRatio !== 1) { Render.setPixelRatio(render, render.options.pixelRatio); } if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('Render.create: options.element was undefined, render.canvas was created but not appended', 'warn'); } return render; }; /** * Continuously updates the render canvas on the `requestAnimationFrame` event. * @method run * @param {render} render */ Render.run = function(render) { (function loop(time){ render.frameRequestId = _requestAnimationFrame(loop); Render.world(render); })(); }; /** * Ends execution of `Render.run` on the given `render`, by canceling the animation frame request event loop. * @method stop * @param {render} render */ Render.stop = function(render) { _cancelAnimationFrame(render.frameRequestId); }; /** * Sets the pixel ratio of the renderer and updates the canvas. * To automatically detect the correct ratio, pass the string `'auto'` for `pixelRatio`. * @method setPixelRatio * @param {render} render * @param {number} pixelRatio */ Render.setPixelRatio = function(render, pixelRatio) { var options = render.options, canvas = render.canvas; if (pixelRatio === 'auto') { pixelRatio = _getPixelRatio(canvas); } options.pixelRatio = pixelRatio; canvas.setAttribute('data-pixel-ratio', pixelRatio); canvas.width = options.width * pixelRatio; canvas.height = options.height * pixelRatio; canvas.style.width = options.width + 'px'; canvas.style.height = options.height + 'px'; render.context.scale(pixelRatio, pixelRatio); }; /** * Renders the given `engine`'s `Matter.World` object. * This is the entry point for all rendering and should be called every time the scene changes. * @method world * @param {render} render */ Render.world = function(render) { var engine = render.engine, world = engine.world, canvas = render.canvas, context = render.context, options = render.options, allBodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world), background = options.wireframes ? options.wireframeBackground : options.background, bodies = [], constraints = [], i; var event = { timestamp: engine.timing.timestamp }; Events.trigger(render, 'beforeRender', event); // apply background if it has changed if (render.currentBackground !== background) _applyBackground(render, background); // clear the canvas with a transparent fill, to allow the canvas background to show context.globalCompositeOperation = 'source-in'; context.fillStyle = "transparent"; context.fillRect(0, 0, canvas.width, canvas.height); context.globalCompositeOperation = 'source-over'; // handle bounds if (options.hasBounds) { var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / options.width, boundsScaleY = boundsHeight / options.height; // filter out bodies that are not in view for (i = 0; i < allBodies.length; i++) { var body = allBodies[i]; if (Bounds.overlaps(body.bounds, render.bounds)) bodies.push(body); } // filter out constraints that are not in view for (i = 0; i < allConstraints.length; i++) { var constraint = allConstraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld)) constraints.push(constraint); } // transform the view context.scale(1 / boundsScaleX, 1 / boundsScaleY); context.translate(-render.bounds.min.x, -render.bounds.min.y); } else { constraints = allConstraints; bodies = allBodies; } if (!options.wireframes || (engine.enableSleeping && options.showSleeping)) { // fully featured rendering of bodies Render.bodies(render, bodies, context); } else { if (options.showConvexHulls) Render.bodyConvexHulls(render, bodies, context); // optimised method for wireframes only Render.bodyWireframes(render, bodies, context); } if (options.showBounds) Render.bodyBounds(render, bodies, context); if (options.showAxes || options.showAngleIndicator) Render.bodyAxes(render, bodies, context); if (options.showPositions) Render.bodyPositions(render, bodies, context); if (options.showVelocity) Render.bodyVelocity(render, bodies, context); if (options.showIds) Render.bodyIds(render, bodies, context); if (options.showSeparations) Render.separations(render, engine.pairs.list, context); if (options.showCollisions) Render.collisions(render, engine.pairs.list, context); if (options.showVertexNumbers) Render.vertexNumbers(render, bodies, context); if (options.showMousePosition) Render.mousePosition(render, render.mouse, context); Render.constraints(constraints, context); if (options.showBroadphase && engine.broadphase.controller === Grid) Render.grid(render, engine.broadphase, context); if (options.showDebug) Render.debug(render, context); if (options.hasBounds) { // revert view transforms context.setTransform(options.pixelRatio, 0, 0, options.pixelRatio, 0, 0); } Events.trigger(render, 'afterRender', event); }; /** * Description * @private * @method debug * @param {render} render * @param {RenderingContext} context */ Render.debug = function(render, context) { var c = context, engine = render.engine, world = engine.world, metrics = engine.metrics, options = render.options, bodies = Composite.allBodies(world), space = " "; if (engine.timing.timestamp - (render.debugTimestamp || 0) >= 500) { var text = ""; if (metrics.timing) { text += "fps: " + Math.round(metrics.timing.fps) + space; } render.debugString = text; render.debugTimestamp = engine.timing.timestamp; } if (render.debugString) { c.font = "12px Arial"; if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.5)'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } var split = render.debugString.split('\n'); for (var i = 0; i < split.length; i++) { c.fillText(split[i], 50, 50 + i * 18); } } }; /** * Description * @private * @method constraints * @param {constraint[]} constraints * @param {RenderingContext} context */ Render.constraints = function(constraints, context) { var c = context; for (var i = 0; i < constraints.length; i++) { var constraint = constraints[i]; if (!constraint.render.visible || !constraint.pointA || !constraint.pointB) continue; var bodyA = constraint.bodyA, bodyB = constraint.bodyB; if (bodyA) { c.beginPath(); c.moveTo(bodyA.position.x + constraint.pointA.x, bodyA.position.y + constraint.pointA.y); } else { c.beginPath(); c.moveTo(constraint.pointA.x, constraint.pointA.y); } if (bodyB) { c.lineTo(bodyB.position.x + constraint.pointB.x, bodyB.position.y + constraint.pointB.y); } else { c.lineTo(constraint.pointB.x, constraint.pointB.y); } c.lineWidth = constraint.render.lineWidth; c.strokeStyle = constraint.render.strokeStyle; c.stroke(); } }; /** * Description * @private * @method bodyShadows * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyShadows = function(render, bodies, context) { var c = context, engine = render.engine; for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; if (body.circleRadius) { c.beginPath(); c.arc(body.position.x, body.position.y, body.circleRadius, 0, 2 * Math.PI); c.closePath(); } else { c.beginPath(); c.moveTo(body.vertices[0].x, body.vertices[0].y); for (var j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.closePath(); } var distanceX = body.position.x - render.options.width * 0.5, distanceY = body.position.y - render.options.height * 0.2, distance = Math.abs(distanceX) + Math.abs(distanceY); c.shadowColor = 'rgba(0,0,0,0.15)'; c.shadowOffsetX = 0.05 * distanceX; c.shadowOffsetY = 0.05 * distanceY; c.shadowBlur = 1 + 12 * Math.min(1, distance / 1000); c.fill(); c.shadowColor = null; c.shadowOffsetX = null; c.shadowOffsetY = null; c.shadowBlur = null; } }; /** * Description * @private * @method bodies * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodies = function(render, bodies, context) { var c = context, engine = render.engine, options = render.options, showInternalEdges = options.showInternalEdges || !options.wireframes, body, part, i, k; for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (!body.render.visible) continue; // handle compound parts for (k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) { part = body.parts[k]; if (!part.render.visible) continue; if (options.showSleeping && body.isSleeping) { c.globalAlpha = 0.5 * part.render.opacity; } else if (part.render.opacity !== 1) { c.globalAlpha = part.render.opacity; } if (part.render.sprite && part.render.sprite.texture && !options.wireframes) { // part sprite var sprite = part.render.sprite, texture = _getTexture(render, sprite.texture); c.translate(part.position.x, part.position.y); c.rotate(part.angle); c.drawImage( texture, texture.width * -sprite.xOffset * sprite.xScale, texture.height * -sprite.yOffset * sprite.yScale, texture.width * sprite.xScale, texture.height * sprite.yScale ); // revert translation, hopefully faster than save / restore c.rotate(-part.angle); c.translate(-part.position.x, -part.position.y); } else { // part polygon if (part.circleRadius) { c.beginPath(); c.arc(part.position.x, part.position.y, part.circleRadius, 0, 2 * Math.PI); } else { c.beginPath(); c.moveTo(part.vertices[0].x, part.vertices[0].y); for (var j = 1; j < part.vertices.length; j++) { if (!part.vertices[j - 1].isInternal || showInternalEdges) { c.lineTo(part.vertices[j].x, part.vertices[j].y); } else { c.moveTo(part.vertices[j].x, part.vertices[j].y); } if (part.vertices[j].isInternal && !showInternalEdges) { c.moveTo(part.vertices[(j + 1) % part.vertices.length].x, part.vertices[(j + 1) % part.vertices.length].y); } } c.lineTo(part.vertices[0].x, part.vertices[0].y); c.closePath(); } if (!options.wireframes) { c.fillStyle = part.render.fillStyle; c.lineWidth = part.render.lineWidth; c.strokeStyle = part.render.strokeStyle; c.fill(); } else { c.lineWidth = 1; c.strokeStyle = '#bbb'; } c.stroke(); } c.globalAlpha = 1; } } }; /** * Optimised method for drawing body wireframes in one pass * @private * @method bodyWireframes * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyWireframes = function(render, bodies, context) { var c = context, showInternalEdges = render.options.showInternalEdges, body, part, i, j, k; c.beginPath(); // render all bodies for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (!body.render.visible) continue; // handle compound parts for (k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) { part = body.parts[k]; c.moveTo(part.vertices[0].x, part.vertices[0].y); for (j = 1; j < part.vertices.length; j++) { if (!part.vertices[j - 1].isInternal || showInternalEdges) { c.lineTo(part.vertices[j].x, part.vertices[j].y); } else { c.moveTo(part.vertices[j].x, part.vertices[j].y); } if (part.vertices[j].isInternal && !showInternalEdges) { c.moveTo(part.vertices[(j + 1) % part.vertices.length].x, part.vertices[(j + 1) % part.vertices.length].y); } } c.lineTo(part.vertices[0].x, part.vertices[0].y); } } c.lineWidth = 1; c.strokeStyle = '#bbb'; c.stroke(); }; /** * Optimised method for drawing body convex hull wireframes in one pass * @private * @method bodyConvexHulls * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyConvexHulls = function(render, bodies, context) { var c = context, body, part, i, j, k; c.beginPath(); // render convex hulls for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (!body.render.visible || body.parts.length === 1) continue; c.moveTo(body.vertices[0].x, body.vertices[0].y); for (j = 1; j < body.vertices.length; j++) { c.lineTo(body.vertices[j].x, body.vertices[j].y); } c.lineTo(body.vertices[0].x, body.vertices[0].y); } c.lineWidth = 1; c.strokeStyle = 'rgba(255,255,255,0.2)'; c.stroke(); }; /** * Renders body vertex numbers. * @private * @method vertexNumbers * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.vertexNumbers = function(render, bodies, context) { var c = context, i, j, k; for (i = 0; i < bodies.length; i++) { var parts = bodies[i].parts; for (k = parts.length > 1 ? 1 : 0; k < parts.length; k++) { var part = parts[k]; for (j = 0; j < part.vertices.length; j++) { c.fillStyle = 'rgba(255,255,255,0.2)'; c.fillText(i + '_' + j, part.position.x + (part.vertices[j].x - part.position.x) * 0.8, part.position.y + (part.vertices[j].y - part.position.y) * 0.8); } } } }; /** * Renders mouse position. * @private * @method mousePosition * @param {render} render * @param {mouse} mouse * @param {RenderingContext} context */ Render.mousePosition = function(render, mouse, context) { var c = context; c.fillStyle = 'rgba(255,255,255,0.8)'; c.fillText(mouse.position.x + ' ' + mouse.position.y, mouse.position.x + 5, mouse.position.y - 5); }; /** * Draws body bounds * @private * @method bodyBounds * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyBounds = function(render, bodies, context) { var c = context, engine = render.engine, options = render.options; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (body.render.visible) { var parts = bodies[i].parts; for (var j = parts.length > 1 ? 1 : 0; j < parts.length; j++) { var part = parts[j]; c.rect(part.bounds.min.x, part.bounds.min.y, part.bounds.max.x - part.bounds.min.x, part.bounds.max.y - part.bounds.min.y); } } } if (options.wireframes) { c.strokeStyle = 'rgba(255,255,255,0.08)'; } else { c.strokeStyle = 'rgba(0,0,0,0.1)'; } c.lineWidth = 1; c.stroke(); }; /** * Draws body angle indicators and axes * @private * @method bodyAxes * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyAxes = function(render, bodies, context) { var c = context, engine = render.engine, options = render.options, part, i, j, k; c.beginPath(); for (i = 0; i < bodies.length; i++) { var body = bodies[i], parts = body.parts; if (!body.render.visible) continue; if (options.showAxes) { // render all axes for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) { part = parts[j]; for (k = 0; k < part.axes.length; k++) { var axis = part.axes[k]; c.moveTo(part.position.x, part.position.y); c.lineTo(part.position.x + axis.x * 20, part.position.y + axis.y * 20); } } } else { for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) { part = parts[j]; for (k = 0; k < part.axes.length; k++) { // render a single axis indicator c.moveTo(part.position.x, part.position.y); c.lineTo((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2, (part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2); } } } } if (options.wireframes) { c.strokeStyle = 'indianred'; } else { c.strokeStyle = 'rgba(0,0,0,0.8)'; c.globalCompositeOperation = 'overlay'; } c.lineWidth = 1; c.stroke(); c.globalCompositeOperation = 'source-over'; }; /** * Draws body positions * @private * @method bodyPositions * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyPositions = function(render, bodies, context) { var c = context, engine = render.engine, options = render.options, body, part, i, k; c.beginPath(); // render current positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (!body.render.visible) continue; // handle compound parts for (k = 0; k < body.parts.length; k++) { part = body.parts[k]; c.arc(part.position.x, part.position.y, 3, 0, 2 * Math.PI, false); c.closePath(); } } if (options.wireframes) { c.fillStyle = 'indianred'; } else { c.fillStyle = 'rgba(0,0,0,0.5)'; } c.fill(); c.beginPath(); // render previous positions for (i = 0; i < bodies.length; i++) { body = bodies[i]; if (body.render.visible) { c.arc(body.positionPrev.x, body.positionPrev.y, 2, 0, 2 * Math.PI, false); c.closePath(); } } c.fillStyle = 'rgba(255,165,0,0.8)'; c.fill(); }; /** * Draws body velocity * @private * @method bodyVelocity * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyVelocity = function(render, bodies, context) { var c = context; c.beginPath(); for (var i = 0; i < bodies.length; i++) { var body = bodies[i]; if (!body.render.visible) continue; c.moveTo(body.position.x, body.position.y); c.lineTo(body.position.x + (body.position.x - body.positionPrev.x) * 2, body.position.y + (body.position.y - body.positionPrev.y) * 2); } c.lineWidth = 3; c.strokeStyle = 'cornflowerblue'; c.stroke(); }; /** * Draws body ids * @private * @method bodyIds * @param {render} render * @param {body[]} bodies * @param {RenderingContext} context */ Render.bodyIds = function(render, bodies, context) { var c = context, i, j; for (i = 0; i < bodies.length; i++) { if (!bodies[i].render.visible) continue; var parts = bodies[i].parts; for (j = parts.length > 1 ? 1 : 0; j < parts.length; j++) { var part = parts[j]; c.font = "12px Arial"; c.fillStyle = 'rgba(255,255,255,0.5)'; c.fillText(part.id, part.position.x + 10, part.position.y - 10); } } }; /** * Description * @private * @method collisions * @param {render} render * @param {pair[]} pairs * @param {RenderingContext} context */ Render.collisions = function(render, pairs, context) { var c = context, options = render.options, pair, collision, corrected, bodyA, bodyB, i, j; c.beginPath(); // render collision positions for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; for (j = 0; j < pair.activeContacts.length; j++) { var contact = pair.activeContacts[j], vertex = contact.vertex; c.rect(vertex.x - 1.5, vertex.y - 1.5, 3.5, 3.5); } } if (options.wireframes) { c.fillStyle = 'rgba(255,255,255,0.7)'; } else { c.fillStyle = 'orange'; } c.fill(); c.beginPath(); // render collision normals for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; if (pair.activeContacts.length > 0) { var normalPosX = pair.activeContacts[0].vertex.x, normalPosY = pair.activeContacts[0].vertex.y; if (pair.activeContacts.length === 2) { normalPosX = (pair.activeContacts[0].vertex.x + pair.activeContacts[1].vertex.x) / 2; normalPosY = (pair.activeContacts[0].vertex.y + pair.activeContacts[1].vertex.y) / 2; } if (collision.bodyB === collision.supports[0].body || collision.bodyA.isStatic === true) { c.moveTo(normalPosX - collision.normal.x * 8, normalPosY - collision.normal.y * 8); } else { c.moveTo(normalPosX + collision.normal.x * 8, normalPosY + collision.normal.y * 8); } c.lineTo(normalPosX, normalPosY); } } if (options.wireframes) { c.strokeStyle = 'rgba(255,165,0,0.7)'; } else { c.strokeStyle = 'orange'; } c.lineWidth = 1; c.stroke(); }; /** * Description * @private * @method separations * @param {render} render * @param {pair[]} pairs * @param {RenderingContext} context */ Render.separations = function(render, pairs, context) { var c = context, options = render.options, pair, collision, corrected, bodyA, bodyB, i, j; c.beginPath(); // render separations for (i = 0; i < pairs.length; i++) { pair = pairs[i]; if (!pair.isActive) continue; collision = pair.collision; bodyA = collision.bodyA; bodyB = collision.bodyB; var k = 1; if (!bodyB.isStatic && !bodyA.isStatic) k = 0.5; if (bodyB.isStatic) k = 0; c.moveTo(bodyB.position.x, bodyB.position.y); c.lineTo(bodyB.position.x - collision.penetration.x * k, bodyB.position.y - collision.penetration.y * k); k = 1; if (!bodyB.isStatic && !bodyA.isStatic) k = 0.5; if (bodyA.isStatic) k = 0; c.moveTo(bodyA.position.x, bodyA.position.y); c.lineTo(bodyA.position.x + collision.penetration.x * k, bodyA.position.y + collision.penetration.y * k); } if (options.wireframes) { c.strokeStyle = 'rgba(255,165,0,0.5)'; } else { c.strokeStyle = 'orange'; } c.stroke(); }; /** * Description * @private * @method grid * @param {render} render * @param {grid} grid * @param {RenderingContext} context */ Render.grid = function(render, grid, context) { var c = context, options = render.options; if (options.wireframes) { c.strokeStyle = 'rgba(255,180,0,0.1)'; } else { c.strokeStyle = 'rgba(255,180,0,0.5)'; } c.beginPath(); var bucketKeys = Common.keys(grid.buckets); for (var i = 0; i < bucketKeys.length; i++) { var bucketId = bucketKeys[i]; if (grid.buckets[bucketId].length < 2) continue; var region = bucketId.split(','); c.rect(0.5 + parseInt(region[0], 10) * grid.bucketWidth, 0.5 + parseInt(region[1], 10) * grid.bucketHeight, grid.bucketWidth, grid.bucketHeight); } c.lineWidth = 1; c.stroke(); }; /** * Description * @private * @method inspector * @param {inspector} inspector * @param {RenderingContext} context */ Render.inspector = function(inspector, context) { var engine = inspector.engine, selected = inspector.selected, render = inspector.render, options = render.options, bounds; if (options.hasBounds) { var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; context.scale(1 / boundsScaleX, 1 / boundsScaleY); context.translate(-render.bounds.min.x, -render.bounds.min.y); } for (var i = 0; i < selected.length; i++) { var item = selected[i].data; context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.9)'; context.setLineDash([1,2]); switch (item.type) { case 'body': // render body selections bounds = item.bounds; context.beginPath(); context.rect(Math.floor(bounds.min.x - 3), Math.floor(bounds.min.y - 3), Math.floor(bounds.max.x - bounds.min.x + 6), Math.floor(bounds.max.y - bounds.min.y + 6)); context.closePath(); context.stroke(); break; case 'constraint': // render constraint selections var point = item.pointA; if (item.bodyA) point = item.pointB; context.beginPath(); context.arc(point.x, point.y, 10, 0, 2 * Math.PI); context.closePath(); context.stroke(); break; } context.setLineDash([]); context.translate(-0.5, -0.5); } // render selection region if (inspector.selectStart !== null) { context.translate(0.5, 0.5); context.lineWidth = 1; context.strokeStyle = 'rgba(255,165,0,0.6)'; context.fillStyle = 'rgba(255,165,0,0.1)'; bounds = inspector.selectBounds; context.beginPath(); context.rect(Math.floor(bounds.min.x), Math.floor(bounds.min.y), Math.floor(bounds.max.x - bounds.min.x), Math.floor(bounds.max.y - bounds.min.y)); context.closePath(); context.stroke(); context.fill(); context.translate(-0.5, -0.5); } if (options.hasBounds) context.setTransform(1, 0, 0, 1, 0, 0); }; /** * Description * @method _createCanvas * @private * @param {} width * @param {} height * @return canvas */ var _createCanvas = function(width, height) { var canvas = document.createElement('canvas'); canvas.width = width; canvas.height = height; canvas.oncontextmenu = function() { return false; }; canvas.onselectstart = function() { return false; }; return canvas; }; /** * Gets the pixel ratio of the canvas. * @method _getPixelRatio * @private * @param {HTMLElement} canvas * @return {Number} pixel ratio */ var _getPixelRatio = function(canvas) { var context = canvas.getContext('2d'), devicePixelRatio = window.devicePixelRatio || 1, backingStorePixelRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1; return devicePixelRatio / backingStorePixelRatio; }; /** * Gets the requested texture (an Image) via its path * @method _getTexture * @private * @param {render} render * @param {string} imagePath * @return {Image} texture */ var _getTexture = function(render, imagePath) { var image = render.textures[imagePath]; if (image) return image; image = render.textures[imagePath] = new Image(); image.src = imagePath; return image; }; /** * Applies the background to the canvas using CSS. * @method applyBackground * @private * @param {render} render * @param {string} background */ var _applyBackground = function(render, background) { var cssBackground = background; if (/(jpg|gif|png)$/.test(background)) cssBackground = 'url(' + background + ')'; render.canvas.style.background = cssBackground; render.canvas.style.backgroundSize = "contain"; render.currentBackground = background; }; /* * * Events Documentation * */ /** * Fired before rendering * * @event beforeRender * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /** * Fired after rendering * * @event afterRender * @param {} event An event object * @param {number} event.timestamp The engine.timing.timestamp of the event * @param {} event.source The source object of the event * @param {} event.name The name of the event */ /* * * Properties Documentation * */ /** * A back-reference to the `Matter.Render` module. * * @property controller * @type render */ /** * A reference to the `Matter.Engine` instance to be used. * * @property engine * @type engine */ /** * A reference to the element where the canvas is to be inserted (if `render.canvas` has not been specified) * * @property element * @type HTMLElement * @default null */ /** * The canvas element to render to. If not specified, one will be created if `render.element` has been specified. * * @property canvas * @type HTMLCanvasElement * @default null */ /** * The configuration options of the renderer. * * @property options * @type {} */ /** * The target width in pixels of the `render.canvas` to be created. * * @property options.width * @type number * @default 800 */ /** * The target height in pixels of the `render.canvas` to be created. * * @property options.height * @type number * @default 600 */ /** * A flag that specifies if `render.bounds` should be used when rendering. * * @property options.hasBounds * @type boolean * @default false */ /** * A `Bounds` object that specifies the drawing view region. * Rendering will be automatically transformed and scaled to fit within the canvas size (`render.options.width` and `render.options.height`). * This allows for creating views that can pan or zoom around the scene. * You must also set `render.options.hasBounds` to `true` to enable bounded rendering. * * @property bounds * @type bounds */ /** * The 2d rendering context from the `render.canvas` element. * * @property context * @type CanvasRenderingContext2D */ /** * The sprite texture cache. * * @property textures * @type {} */ })(); },{"../body/Composite":2,"../collision/Grid":6,"../core/Common":14,"../core/Events":16,"../geometry/Bounds":24,"../geometry/Vector":26}],30:[function(require,module,exports){ /** * The `Matter.RenderPixi` module is an example renderer using pixi.js. * See also `Matter.Render` for a canvas based renderer. * * @class RenderPixi * @deprecated the Matter.RenderPixi module will soon be removed from the Matter.js core. * It will likely be moved to its own repository (but maintenance will be limited). */ var RenderPixi = {}; module.exports = RenderPixi; var Composite = require('../body/Composite'); var Common = require('../core/Common'); (function() { var _requestAnimationFrame, _cancelAnimationFrame; if (typeof window !== 'undefined') { _requestAnimationFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.msRequestAnimationFrame || function(callback){ window.setTimeout(function() { callback(Common.now()); }, 1000 / 60); }; _cancelAnimationFrame = window.cancelAnimationFrame || window.mozCancelAnimationFrame || window.webkitCancelAnimationFrame || window.msCancelAnimationFrame; } /** * Creates a new Pixi.js WebGL renderer * @method create * @param {object} options * @return {RenderPixi} A new renderer * @deprecated */ RenderPixi.create = function(options) { Common.log('RenderPixi.create: Matter.RenderPixi is deprecated (see docs)', 'warn'); var defaults = { controller: RenderPixi, engine: null, element: null, frameRequestId: null, canvas: null, renderer: null, container: null, spriteContainer: null, pixiOptions: null, options: { width: 800, height: 600, background: '#fafafa', wireframeBackground: '#222', hasBounds: false, enabled: true, wireframes: true, showSleeping: true, showDebug: false, showBroadphase: false, showBounds: false, showVelocity: false, showCollisions: false, showAxes: false, showPositions: false, showAngleIndicator: false, showIds: false, showShadows: false } }; var render = Common.extend(defaults, options), transparent = !render.options.wireframes && render.options.background === 'transparent'; // init pixi render.pixiOptions = render.pixiOptions || { view: render.canvas, transparent: transparent, antialias: true, backgroundColor: options.background }; render.mouse = options.mouse; render.engine = options.engine; render.renderer = render.renderer || new PIXI.WebGLRenderer(render.options.width, render.options.height, render.pixiOptions); render.container = render.container || new PIXI.Container(); render.spriteContainer = render.spriteContainer || new PIXI.Container(); render.canvas = render.canvas || render.renderer.view; render.bounds = render.bounds || { min: { x: 0, y: 0 }, max: { x: render.options.width, y: render.options.height } }; // caches render.textures = {}; render.sprites = {}; render.primitives = {}; // use a sprite batch for performance render.container.addChild(render.spriteContainer); // insert canvas if (Common.isElement(render.element)) { render.element.appendChild(render.canvas); } else { Common.log('No "render.element" passed, "render.canvas" was not inserted into document.', 'warn'); } // prevent menus on canvas render.canvas.oncontextmenu = function() { return false; }; render.canvas.onselectstart = function() { return false; }; return render; }; /** * Continuously updates the render canvas on the `requestAnimationFrame` event. * @method run * @param {render} render * @deprecated */ RenderPixi.run = function(render) { (function loop(time){ render.frameRequestId = _requestAnimationFrame(loop); RenderPixi.world(render); })(); }; /** * Ends execution of `Render.run` on the given `render`, by canceling the animation frame request event loop. * @method stop * @param {render} render * @deprecated */ RenderPixi.stop = function(render) { _cancelAnimationFrame(render.frameRequestId); }; /** * Clears the scene graph * @method clear * @param {RenderPixi} render * @deprecated */ RenderPixi.clear = function(render) { var container = render.container, spriteContainer = render.spriteContainer; // clear stage container while (container.children[0]) { container.removeChild(container.children[0]); } // clear sprite batch while (spriteContainer.children[0]) { spriteContainer.removeChild(spriteContainer.children[0]); } var bgSprite = render.sprites['bg-0']; // clear caches render.textures = {}; render.sprites = {}; render.primitives = {}; // set background sprite render.sprites['bg-0'] = bgSprite; if (bgSprite) container.addChildAt(bgSprite, 0); // add sprite batch back into container render.container.addChild(render.spriteContainer); // reset background state render.currentBackground = null; // reset bounds transforms container.scale.set(1, 1); container.position.set(0, 0); }; /** * Sets the background of the canvas * @method setBackground * @param {RenderPixi} render * @param {string} background * @deprecated */ RenderPixi.setBackground = function(render, background) { if (render.currentBackground !== background) { var isColor = background.indexOf && background.indexOf('#') !== -1, bgSprite = render.sprites['bg-0']; if (isColor) { // if solid background color var color = Common.colorToNumber(background); render.renderer.backgroundColor = color; // remove background sprite if existing if (bgSprite) render.container.removeChild(bgSprite); } else { // initialise background sprite if needed if (!bgSprite) { var texture = _getTexture(render, background); bgSprite = render.sprites['bg-0'] = new PIXI.Sprite(texture); bgSprite.position.x = 0; bgSprite.position.y = 0; render.container.addChildAt(bgSprite, 0); } } render.currentBackground = background; } }; /** * Description * @method world * @param {engine} engine * @deprecated */ RenderPixi.world = function(render) { var engine = render.engine, world = engine.world, renderer = render.renderer, container = render.container, options = render.options, bodies = Composite.allBodies(world), allConstraints = Composite.allConstraints(world), constraints = [], i; if (options.wireframes) { RenderPixi.setBackground(render, options.wireframeBackground); } else { RenderPixi.setBackground(render, options.background); } // handle bounds var boundsWidth = render.bounds.max.x - render.bounds.min.x, boundsHeight = render.bounds.max.y - render.bounds.min.y, boundsScaleX = boundsWidth / render.options.width, boundsScaleY = boundsHeight / render.options.height; if (options.hasBounds) { // Hide bodies that are not in view for (i = 0; i < bodies.length; i++) { var body = bodies[i]; body.render.sprite.visible = Bounds.overlaps(body.bounds, render.bounds); } // filter out constraints that are not in view for (i = 0; i < allConstraints.length; i++) { var constraint = allConstraints[i], bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointAWorld = constraint.pointA, pointBWorld = constraint.pointB; if (bodyA) pointAWorld = Vector.add(bodyA.position, constraint.pointA); if (bodyB) pointBWorld = Vector.add(bodyB.position, constraint.pointB); if (!pointAWorld || !pointBWorld) continue; if (Bounds.contains(render.bounds, pointAWorld) || Bounds.contains(render.bounds, pointBWorld)) constraints.push(constraint); } // transform the view container.scale.set(1 / boundsScaleX, 1 / boundsScaleY); container.position.set(-render.bounds.min.x * (1 / boundsScaleX), -render.bounds.min.y * (1 / boundsScaleY)); } else { constraints = allConstraints; } for (i = 0; i < bodies.length; i++) RenderPixi.body(render, bodies[i]); for (i = 0; i < constraints.length; i++) RenderPixi.constraint(render, constraints[i]); renderer.render(container); }; /** * Description * @method constraint * @param {engine} engine * @param {constraint} constraint * @deprecated */ RenderPixi.constraint = function(render, constraint) { var engine = render.engine, bodyA = constraint.bodyA, bodyB = constraint.bodyB, pointA = constraint.pointA, pointB = constraint.pointB, container = render.container, constraintRender = constraint.render, primitiveId = 'c-' + constraint.id, primitive = render.primitives[primitiveId]; // initialise constraint primitive if not existing if (!primitive) primitive = render.primitives[primitiveId] = new PIXI.Graphics(); // don't render if constraint does not have two end points if (!constraintRender.visible || !constraint.pointA || !constraint.pointB) { primitive.clear(); return; } // add to scene graph if not already there if (Common.indexOf(container.children, primitive) === -1) container.addChild(primitive); // render the constraint on every update, since they can change dynamically primitive.clear(); primitive.beginFill(0, 0); primitive.lineStyle(constraintRender.lineWidth, Common.colorToNumber(constraintRender.strokeStyle), 1); if (bodyA) { primitive.moveTo(bodyA.position.x + pointA.x, bodyA.position.y + pointA.y); } else { primitive.moveTo(pointA.x, pointA.y); } if (bodyB) { primitive.lineTo(bodyB.position.x + pointB.x, bodyB.position.y + pointB.y); } else { primitive.lineTo(pointB.x, pointB.y); } primitive.endFill(); }; /** * Description * @method body * @param {engine} engine * @param {body} body * @deprecated */ RenderPixi.body = function(render, body) { var engine = render.engine, bodyRender = body.render; if (!bodyRender.visible) return; if (bodyRender.sprite && bodyRender.sprite.texture) { var spriteId = 'b-' + body.id, sprite = render.sprites[spriteId], spriteContainer = render.spriteContainer; // initialise body sprite if not existing if (!sprite) sprite = render.sprites[spriteId] = _createBodySprite(render, body); // add to scene graph if not already there if (Common.indexOf(spriteContainer.children, sprite) === -1) spriteContainer.addChild(sprite); // update body sprite sprite.position.x = body.position.x; sprite.position.y = body.position.y; sprite.rotation = body.angle; sprite.scale.x = bodyRender.sprite.xScale || 1; sprite.scale.y = bodyRender.sprite.yScale || 1; } else { var primitiveId = 'b-' + body.id, primitive = render.primitives[primitiveId], container = render.container; // initialise body primitive if not existing if (!primitive) { primitive = render.primitives[primitiveId] = _createBodyPrimitive(render, body); primitive.initialAngle = body.angle; } // add to scene graph if not already there if (Common.indexOf(container.children, primitive) === -1) container.addChild(primitive); // update body primitive primitive.position.x = body.position.x; primitive.position.y = body.position.y; primitive.rotation = body.angle - primitive.initialAngle; } }; /** * Creates a body sprite * @method _createBodySprite * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Sprite} sprite * @deprecated */ var _createBodySprite = function(render, body) { var bodyRender = body.render, texturePath = bodyRender.sprite.texture, texture = _getTexture(render, texturePath), sprite = new PIXI.Sprite(texture); sprite.anchor.x = body.render.sprite.xOffset; sprite.anchor.y = body.render.sprite.yOffset; return sprite; }; /** * Creates a body primitive * @method _createBodyPrimitive * @private * @param {RenderPixi} render * @param {body} body * @return {PIXI.Graphics} graphics * @deprecated */ var _createBodyPrimitive = function(render, body) { var bodyRender = body.render, options = render.options, primitive = new PIXI.Graphics(), fillStyle = Common.colorToNumber(bodyRender.fillStyle), strokeStyle = Common.colorToNumber(bodyRender.strokeStyle), strokeStyleIndicator = Common.colorToNumber(bodyRender.strokeStyle), strokeStyleWireframe = Common.colorToNumber('#bbb'), strokeStyleWireframeIndicator = Common.colorToNumber('#CD5C5C'), part; primitive.clear(); // handle compound parts for (var k = body.parts.length > 1 ? 1 : 0; k < body.parts.length; k++) { part = body.parts[k]; if (!options.wireframes) { primitive.beginFill(fillStyle, 1); primitive.lineStyle(bodyRender.lineWidth, strokeStyle, 1); } else { primitive.beginFill(0, 0); primitive.lineStyle(1, strokeStyleWireframe, 1); } primitive.moveTo(part.vertices[0].x - body.position.x, part.vertices[0].y - body.position.y); for (var j = 1; j < part.vertices.length; j++) { primitive.lineTo(part.vertices[j].x - body.position.x, part.vertices[j].y - body.position.y); } primitive.lineTo(part.vertices[0].x - body.position.x, part.vertices[0].y - body.position.y); primitive.endFill(); // angle indicator if (options.showAngleIndicator || options.showAxes) { primitive.beginFill(0, 0); if (options.wireframes) { primitive.lineStyle(1, strokeStyleWireframeIndicator, 1); } else { primitive.lineStyle(1, strokeStyleIndicator); } primitive.moveTo(part.position.x - body.position.x, part.position.y - body.position.y); primitive.lineTo(((part.vertices[0].x + part.vertices[part.vertices.length-1].x) / 2 - body.position.x), ((part.vertices[0].y + part.vertices[part.vertices.length-1].y) / 2 - body.position.y)); primitive.endFill(); } } return primitive; }; /** * Gets the requested texture (a PIXI.Texture) via its path * @method _getTexture * @private * @param {RenderPixi} render * @param {string} imagePath * @return {PIXI.Texture} texture * @deprecated */ var _getTexture = function(render, imagePath) { var texture = render.textures[imagePath]; if (!texture) texture = render.textures[imagePath] = PIXI.Texture.fromImage(imagePath); return texture; }; })(); },{"../body/Composite":2,"../core/Common":14}]},{},[28])(28) });